EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H24N2O2 |
| Net Charge | 0 |
| Average Mass | 264.369 |
| Monoisotopic Mass | 264.18378 |
| SMILES | CCCCNc1ccc(C(=O)OCCN(C)C)cc1 |
| InChI | InChI=1S/C15H24N2O2/c1-4-5-10-16-14-8-6-13(7-9-14)15(18)19-12-11-17(2)3/h6-9,16H,4-5,10-12H2,1-3H3 |
| InChIKey | GKCBAIGFKIBETG-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | local anaesthetic Any member of a group of drugs that reversibly inhibit the propagation of signals along nerves. Wide variations in potency, stability, toxicity, water-solubility and duration of action determine the route used for administration, e.g. topical, intravenous, epidural or spinal block. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tetracaine (CHEBI:9468) has role local anaesthetic (CHEBI:36333) |
| tetracaine (CHEBI:9468) is a benzoate ester (CHEBI:36054) |
| tetracaine (CHEBI:9468) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| 2-(dimethylamino)ethyl 4-(butylamino)benzoate |
| INNs | Source |
|---|---|
| tetracaine | ChemIDplus |
| tetracaína | WHO MedNet |
| tetracainum | ChemIDplus |
| tétracaïne | WHO MedNet |
| Synonyms | Source |
|---|---|
| 2-(Dimethylamino)ethyl p-(butylamino)benzoate | ChemIDplus |
| Diäthylaminoäthanol ester der p-butylaminobenzösäure | ChemIDplus |
| p-Butylaminobenzoyl-2-dimethylaminoethanol | ChemIDplus |
| Amethocaine | KEGG COMPOUND |
| p-(butylamino)benzoic acid β-(dimethylamino)ethyl ester | ChEBI |
| Brand Name | Source |
|---|---|
| Amethocaine | KEGG DRUG |
| Citations |
|---|