EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H14N2 |
| Net Charge | 0 |
| Average Mass | 234.302 |
| Monoisotopic Mass | 234.11570 |
| SMILES | Cc1cc2ncc(-c3ccccc3)nc2cc1C |
| InChI | InChI=1S/C16H14N2/c1-11-8-14-15(9-12(11)2)18-16(10-17-14)13-6-4-3-5-7-13/h3-10H,1-2H3 |
| InChIKey | FQNCLVJEQCJWSU-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6,7-dimethyl-2-phenylquinoxaline (CHEBI:94668) has role geroprotector (CHEBI:176497) |
| 6,7-dimethyl-2-phenylquinoxaline (CHEBI:94668) is a quinoxaline derivative (CHEBI:38771) |
| Synonyms | Source |
|---|---|
| AG-1295 | ChEBI |
| tyrphostin AG 1295 | ChEBI |
| Citations |
|---|