EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H24N2O4S |
| Net Charge | 0 |
| Average Mass | 328.434 |
| Monoisotopic Mass | 328.14568 |
| SMILES | CCN(CC)CCNC(=O)c1cc(S(C)(=O)=O)ccc1OC |
| InChI | InChI=1S/C15H24N2O4S/c1-5-17(6-2)10-9-16-15(18)13-11-12(22(4,19)20)7-8-14(13)21-3/h7-8,11H,5-6,9-10H2,1-4H3,(H,16,18) |
| InChIKey | JTVPZMFULRWINT-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. anxiolytic drug Anxiolytic drugs are agents that alleviate anxiety, tension, and anxiety disorders, promote sedation, and have a calming effect without affecting clarity of consciousness or neurologic conditions. antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-[2-(diethylamino)ethyl]-2-methoxy-5-methylsulfonylbenzamide (CHEBI:94666) has role antidepressant (CHEBI:35469) |
| N-[2-(diethylamino)ethyl]-2-methoxy-5-methylsulfonylbenzamide (CHEBI:94666) has role antipsychotic agent (CHEBI:35476) |
| N-[2-(diethylamino)ethyl]-2-methoxy-5-methylsulfonylbenzamide (CHEBI:94666) has role anxiolytic drug (CHEBI:35474) |
| N-[2-(diethylamino)ethyl]-2-methoxy-5-methylsulfonylbenzamide (CHEBI:94666) is a benzamides (CHEBI:22702) |
| INN | Source |
|---|---|
| tiaprida | WHO MedNet |
| Synonyms | Source |
|---|---|
| NSC-758225 | ChEMBL |
| thiapride | DrugCentral |
| tiapridal | DrugCentral |
| tiapride | ChEMBL |
| Tiapride | ChEMBL |
| tiapride HCl | DrugCentral |
| Manual Xrefs | Databases |
|---|---|
| 2651 | DrugCentral |
| HMDB0042039 | HMDB |
| LSM-5676 | LINCS |
| Registry Numbers | Sources |
|---|---|
| CAS:51012-32-9 | DrugCentral |
| Citations |
|---|