EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H24N2O4S |
| Net Charge | 0 |
| Average Mass | 328.434 |
| Monoisotopic Mass | 328.14568 |
| SMILES | CCN(CC)CCNC(=O)c1cc(S(C)(=O)=O)ccc1OC |
| InChI | InChI=1S/C15H24N2O4S/c1-5-17(6-2)10-9-16-15(18)13-11-12(22(4,19)20)7-8-14(13)21-3/h7-8,11H,5-6,9-10H2,1-4H3,(H,16,18) |
| InChIKey | JTVPZMFULRWINT-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. anxiolytic drug Anxiolytic drugs are agents that alleviate anxiety, tension, and anxiety disorders, promote sedation, and have a calming effect without affecting clarity of consciousness or neurologic conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-[2-(diethylamino)ethyl]-2-methoxy-5-methylsulfonylbenzamide (CHEBI:94666) has role antidepressant (CHEBI:35469) |
| N-[2-(diethylamino)ethyl]-2-methoxy-5-methylsulfonylbenzamide (CHEBI:94666) has role antipsychotic agent (CHEBI:35476) |
| N-[2-(diethylamino)ethyl]-2-methoxy-5-methylsulfonylbenzamide (CHEBI:94666) has role anxiolytic drug (CHEBI:35474) |
| N-[2-(diethylamino)ethyl]-2-methoxy-5-methylsulfonylbenzamide (CHEBI:94666) is a benzamides (CHEBI:22702) |
| INN | Source |
|---|---|
| tiaprida | WHO MedNet |
| Synonyms | Source |
|---|---|
| NSC-758225 | ChEMBL |
| thiapride | DrugCentral |
| tiapridal | DrugCentral |
| tiapride | ChEMBL |
| Tiapride | ChEMBL |
| tiapride HCl | DrugCentral |
| Manual Xrefs | Databases |
|---|---|
| 2651 | DrugCentral |
| HMDB0042039 | HMDB |
| LSM-5676 | LINCS |
| Registry Numbers | Sources |
|---|---|
| CAS:51012-32-9 | DrugCentral |
| Citations |
|---|