EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H17N3O2 |
| Net Charge | 0 |
| Average Mass | 283.331 |
| Monoisotopic Mass | 283.13208 |
| SMILES | CN(C)CCN1C(=O)c2cccc3cc(N)cc(c23)C1=O |
| InChI | InChI=1S/C16H17N3O2/c1-18(2)6-7-19-15(20)12-5-3-4-10-8-11(17)9-13(14(10)12)16(19)21/h3-5,8-9H,6-7,17H2,1-2H3 |
| InChIKey | UPALIKSFLSVKIS-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-amino-2-[2-(dimethylamino)ethyl]benzo[de]isoquinoline-1,3-dione (CHEBI:94661) has role antineoplastic agent (CHEBI:35610) |
| 5-amino-2-[2-(dimethylamino)ethyl]benzo[de]isoquinoline-1,3-dione (CHEBI:94661) is a isoquinolines (CHEBI:24922) |
| INNs | Source |
|---|---|
| amonafida | WHO MedNet |
| amonafide | WHO MedNet |
| Synonyms | Source |
|---|---|
| amonafide | ChEMBL |
| AS-1413 | ChEMBL |
| Nafidimide | ChEMBL |
| NSC-308847 | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| LSM-5667 | LINCS |
| Citations |
|---|