EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H18O8 |
| Net Charge | 0 |
| Average Mass | 338.312 |
| Monoisotopic Mass | 338.10017 |
| SMILES | COCc1cc(O)c(O)c(O)c1-c1c(COC)cc(O)c(O)c1O |
| InChI | InChI=1S/C16H18O8/c1-23-5-7-3-9(17)13(19)15(21)11(7)12-8(6-24-2)4-10(18)14(20)16(12)22/h3-4,17-22H,5-6H2,1-2H3 |
| InChIKey | NEBCAMAQXZIVRE-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | astringent A compound that causes the contraction of body tissues, typically used to reduce bleeding from minor abrasions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-(methoxymethyl)-4-[2,3,4-trihydroxy-6-(methoxymethyl)phenyl]benzene-1,2,3-triol (CHEBI:94660) is a tannin (CHEBI:26848) |
| Manual Xrefs | Databases |
|---|---|
| LSM-5666 | LINCS |