EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H18N4O5 |
| Net Charge | 0 |
| Average Mass | 334.332 |
| Monoisotopic Mass | 334.12772 |
| SMILES | CO[C@]12[C@H](COC(N)=O)C3=C(C(=O)C(C)=C(N)C3=O)N1C[C@@H]1N[C@@H]12 |
| InChI | InChI=1S/C15H18N4O5/c1-5-9(16)12(21)8-6(4-24-14(17)22)15(23-2)13-7(18-13)3-19(15)10(8)11(5)20/h6-7,13,18H,3-4,16H2,1-2H3,(H2,17,22)/t6-,7+,13+,15+/m1/s1 |
| InChIKey | NWIBSHFKIJFRCO-CDOIZDJWSA-N |
| Roles Classification |
|---|
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. intercalator A role played by a chemical agent which exhibits the capability of occupying space between DNA base pairs due to particular properties in size, shape and charge. Intercalation of chemical compounds in DNA helix can result in replication errors (shift, mutation) or DNA damages. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| LSM-5621 (CHEBI:94648) is a mitomycin (CHEBI:25357) |
| Manual Xrefs | Databases |
|---|---|
| LSM-5621 | LINCS |