EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H9NO6S |
| Net Charge | 0 |
| Average Mass | 235.217 |
| Monoisotopic Mass | 235.01506 |
| SMILES | [H][C@@]12[C@@H](C(=O)O)[C@]1([H])S(=O)(=O)C[C@@]2(N)C(=O)O |
| InChI | InChI=1S/C7H9NO6S/c8-7(6(11)12)1-15(13,14)4-2(3(4)7)5(9)10/h2-4H,1,8H2,(H,9,10)(H,11,12)/t2-,3-,4+,7+/m1/s1 |
| InChIKey | AVDUGNCTZRCAHH-MDASVERJSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | dopamine agonist A drug that binds to and activates dopamine receptors. metabotropic glutamate receptor agonist An agonist that selectively binds to and activates a metabotropic glutamate receptor. |
| Applications: | anxiolytic drug Anxiolytic drugs are agents that alleviate anxiety, tension, and anxiety disorders, promote sedation, and have a calming effect without affecting clarity of consciousness or neurologic conditions. dopamine agonist A drug that binds to and activates dopamine receptors. antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| LY404039 (CHEBI:94640) has role antipsychotic agent (CHEBI:35476) |
| LY404039 (CHEBI:94640) has role anxiolytic drug (CHEBI:35474) |
| LY404039 (CHEBI:94640) has role dopamine agonist (CHEBI:51065) |
| LY404039 (CHEBI:94640) has role metabotropic glutamate receptor agonist (CHEBI:61966) |
| LY404039 (CHEBI:94640) is a bridged compound (CHEBI:35990) |
| LY404039 (CHEBI:94640) is a dicarboxylic acid (CHEBI:35692) |
| LY404039 (CHEBI:94640) is a non-proteinogenic amino acid derivative (CHEBI:83812) |
| LY404039 (CHEBI:94640) is a organic heterobicyclic compound (CHEBI:27171) |
| LY404039 (CHEBI:94640) is a sulfone (CHEBI:35850) |
| IUPAC Name |
|---|
| (1R,4S,5S,6S)-4-amino-2-thiabicyclo[3.1.0]hexane-4,6-dicarboxylic acid 2,2-dioxide |
| Synonyms | Source |
|---|---|
| (1R,4S,5S,6S)-4-amino-2,2-dioxo-2λ6-thiabicyclo[3.1.0]hexane-4,6-dicarboxylic acid | IUPAC |
| (−)-(1R,4S,5S,6S)-4-amino-2-sulfonylbicyclo[3.1.0]-hexane-4,6-dicarboxylic acid | ChEBI |
| LY 404039 | ChemIDplus |
| LY-404,039 | ChEBI |
| LY-404039 | ChemIDplus |
| LY404039 | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 8010312 | ChemSpider |
| C21577 | KEGG COMPOUND |
| LSM-5605 | LINCS |
| Pomaglumetad | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:635318-11-5 | ChemIDplus |
| Citations |
|---|