EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H8O3.C17H22NO |
| Net Charge | +1 |
| Average Mass | 444.551 |
| Monoisotopic Mass | 444.21693 |
| SMILES | C[N+](C)(CCOc1ccccc1)Cc1ccccc1.O=C(O)c1cc2ccccc2cc1O |
| InChI | InChI=1S/C17H22NO.C11H8O3/c1-18(2,15-16-9-5-3-6-10-16)13-14-19-17-11-7-4-8-12-17;12-10-6-8-4-2-1-3-7(8)5-9(10)11(13)14/h3-12H,13-15H2,1-2H3;1-6,12H,(H,13,14)/q+1; |
| InChIKey | PMPQCPQAHTXCDK-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dimethyl-(2-phenoxyethyl)-(phenylmethyl)ammonium 3-hydroxy-2-naphthalenecarboxylic acid (CHEBI:94635) is a naphthoic acid (CHEBI:25483) |
| Manual Xrefs | Databases |
|---|---|
| LSM-5589 | LINCS |