EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H12N2O4S |
| Net Charge | 0 |
| Average Mass | 244.272 |
| Monoisotopic Mass | 244.05178 |
| SMILES | O=C1CC[C@@H](C(=O)N2CSC[C@H]2C(=O)O)N1 |
| InChI | InChI=1S/C9H12N2O4S/c12-7-2-1-5(10-7)8(13)11-4-16-3-6(11)9(14)15/h5-6H,1-4H2,(H,10,12)(H,14,15)/t5-,6-/m0/s1 |
| InChIKey | UUTKICFRNVKFRG-WDSKDSINSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (4R)-3-[oxo-[(2S)-5-oxo-2-pyrrolidinyl]methyl]-4-thiazolidinecarboxylic acid (CHEBI:94618) has role antineoplastic agent (CHEBI:35610) |
| (4R)-3-[oxo-[(2S)-5-oxo-2-pyrrolidinyl]methyl]-4-thiazolidinecarboxylic acid (CHEBI:94618) is a peptide (CHEBI:16670) |
| Synonyms | Source |
|---|---|
| adimod | DrugCentral |
| NSC-759841 | ChEMBL |
| pidotimod | ChEMBL |
| Pidotimod | ChEMBL |
| pigitil | DrugCentral |
| Pilimod | ChEMBL |
| Citations |
|---|