EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H17N3O4S |
| Net Charge | 0 |
| Average Mass | 299.352 |
| Monoisotopic Mass | 299.09398 |
| SMILES | C[C@@H](O)[C@@H]1C(=O)N2C(C(=O)O)=C(SCCN=CN)C[C@H]12 |
| InChI | InChI=1S/C12H17N3O4S/c1-6(16)9-7-4-8(20-3-2-14-5-13)10(12(18)19)15(7)11(9)17/h5-7,9,16H,2-4H2,1H3,(H2,13,14)(H,18,19)/t6-,7-,9+/m1/s1 |
| InChIKey | ZSKVGTPCRGIANV-BHNWBGBOSA-N |
| Roles Classification |
|---|
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (5R,6R)-3-[2-(aminomethylideneamino)ethylthio]-6-[(1R)-1-hydroxyethyl]-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid (CHEBI:94608) is a carbapenems (CHEBI:46633) |
| Manual Xrefs | Databases |
|---|---|
| LSM-5539 | LINCS |