EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H27N5O5 |
| Net Charge | 0 |
| Average Mass | 405.455 |
| Monoisotopic Mass | 405.20122 |
| SMILES | Cn1c(NCCN(CCO)CCCc2ccc([N+](=O)[O-])cc2)cc(=O)n(C)c1=O |
| InChI | InChI=1S/C19H27N5O5/c1-21-17(14-18(26)22(2)19(21)27)20-9-11-23(12-13-25)10-3-4-15-5-7-16(8-6-15)24(28)29/h5-8,14,20,25H,3-4,9-13H2,1-2H3 |
| InChIKey | OEBPANQZQGQPHF-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | anti-arrhythmia drug A drug used for the treatment or prevention of cardiac arrhythmias. Anti-arrhythmia drugs may affect the polarisation-repolarisation phase of the action potential, its excitability or refractoriness, or impulse conduction or membrane responsiveness within cardiac fibres. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Nifekalant (CHEBI:94575) has role anti-arrhythmia drug (CHEBI:38070) |
| Nifekalant (CHEBI:94575) is a amine (CHEBI:32952) |
| Incoming Relation(s) |
| Nifekalant hydrochloride (CHEBI:31909) has part Nifekalant (CHEBI:94575) |
| IUPAC Name |
|---|
| 6-[(2-{(2-hydroxyethyl)[3-(4-nitrophenyl)propyl]amino}ethyl)amino]-1,3-dimethylpyrimidine-2,4(1H,3H)-dione |
| INN | Source |
|---|---|
| nifekalant | WHO MedNet |
| Citations |
|---|