EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H16N6O4S |
| Net Charge | 0 |
| Average Mass | 424.442 |
| Monoisotopic Mass | 424.09537 |
| SMILES | COc1nc(C)cnc1NS(=O)(=O)c1cccnc1-c1ccc(-c2nnco2)cc1 |
| InChI | InChI=1S/C19H16N6O4S/c1-12-10-21-17(19(23-12)28-2)25-30(26,27)15-4-3-9-20-16(15)13-5-7-14(8-6-13)18-24-22-11-29-18/h3-11H,1-2H3,(H,21,25) |
| InChIKey | FJHHZXWJVIEFGJ-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | endothelin A receptor antagonist A endothelin receptor antagonist is a drug which selectively blocks endothelin A receptors. |
| Applications: | antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. hepatoprotective agent Any compound that is able to prevent damage to the liver. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. endothelin A receptor antagonist A endothelin receptor antagonist is a drug which selectively blocks endothelin A receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| zibotentan (CHEBI:94573) has role antihypertensive agent (CHEBI:35674) |
| zibotentan (CHEBI:94573) has role antineoplastic agent (CHEBI:35610) |
| zibotentan (CHEBI:94573) has role endothelin A receptor antagonist (CHEBI:51452) |
| zibotentan (CHEBI:94573) has role hepatoprotective agent (CHEBI:62868) |
| zibotentan (CHEBI:94573) is a 1,3,4-oxadiazoles (CHEBI:46810) |
| zibotentan (CHEBI:94573) is a aromatic ether (CHEBI:35618) |
| zibotentan (CHEBI:94573) is a benzenes (CHEBI:22712) |
| zibotentan (CHEBI:94573) is a phenylpyridine (CHEBI:38193) |
| zibotentan (CHEBI:94573) is a pyrazines (CHEBI:38314) |
| zibotentan (CHEBI:94573) is a pyridinesulfonamide (CHEBI:48100) |
| IUPAC Name |
|---|
| N-(3-methoxy-5-methylpyrazin-2-yl)-2-[4-(1,3,4-oxadiazol-2-yl)phenyl]pyridine-3-sulfonamide |
| INN | Source |
|---|---|
| zibotentan | WHO MedNet |
| Synonyms | Source |
|---|---|
| AZD-4054 | DrugBank |
| N-(3-methoxy-5-methyl-2-pyrazinyl)-2-[4-(1,3,4-oxadiazol-2-yl)phenyl]-3-pyridinesulfonamide | ChEBI |
| ZD 4054 | ChEBI |
| ZD-4054 | DrugBank |
| ZD4054 | DrugBank |
| Manual Xrefs | Databases |
|---|---|
| D07741 | KEGG DRUG |
| DB06629 | DrugBank |
| HMDB0260003 | HMDB |
| LSM-5453 | LINCS |
| Zibotentan | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:186497-07-4 | ChEBI |
| Citations |
|---|