EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H16N6O4S |
| Net Charge | 0 |
| Average Mass | 424.442 |
| Monoisotopic Mass | 424.09537 |
| SMILES | COc1nc(C)cnc1NS(=O)(=O)c1cccnc1-c1ccc(-c2nnco2)cc1 |
| InChI | InChI=1S/C19H16N6O4S/c1-12-10-21-17(19(23-12)28-2)25-30(26,27)15-4-3-9-20-16(15)13-5-7-14(8-6-13)18-24-22-11-29-18/h3-11H,1-2H3,(H,21,25) |
| InChIKey | FJHHZXWJVIEFGJ-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | endothelin A receptor antagonist A endothelin receptor antagonist is a drug which selectively blocks endothelin A receptors. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. endothelin A receptor antagonist A endothelin receptor antagonist is a drug which selectively blocks endothelin A receptors. antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| zibotentan (CHEBI:94573) has role antihypertensive agent (CHEBI:35674) |
| zibotentan (CHEBI:94573) has role antineoplastic agent (CHEBI:35610) |
| zibotentan (CHEBI:94573) has role endothelin A receptor antagonist (CHEBI:51452) |
| zibotentan (CHEBI:94573) is a 1,3,4-oxadiazoles (CHEBI:46810) |
| zibotentan (CHEBI:94573) is a aromatic ether (CHEBI:35618) |
| zibotentan (CHEBI:94573) is a benzenes (CHEBI:22712) |
| zibotentan (CHEBI:94573) is a phenylpyridine (CHEBI:38193) |
| zibotentan (CHEBI:94573) is a pyrazines (CHEBI:38314) |
| zibotentan (CHEBI:94573) is a pyridinesulfonamide (CHEBI:48100) |
| IUPAC Name |
|---|
| N-(3-methoxy-5-methylpyrazin-2-yl)-2-[4-(1,3,4-oxadiazol-2-yl)phenyl]pyridine-3-sulfonamide |
| Synonyms | Source |
|---|---|
| AZD-4054 | DrugBank |
| N-(3-methoxy-5-methyl-2-pyrazinyl)-2-[4-(1,3,4-oxadiazol-2-yl)phenyl]-3-pyridinesulfonamide | ChEBI |
| ZD 4054 | ChEBI |
| ZD-4054 | DrugBank |
| ZD4054 | DrugBank |
| Manual Xrefs | Databases |
|---|---|
| D07741 | KEGG DRUG |
| DB06629 | DrugBank |
| HMDB0260003 | HMDB |
| LSM-5453 | LINCS |
| Zibotentan | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:186497-07-4 | ChEBI |
| Citations |
|---|