EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H16 |
| Net Charge | 0 |
| Average Mass | 136.238 |
| Monoisotopic Mass | 136.12520 |
| SMILES | CC1=CCC(=C(C)C)CC1 |
| InChI | InChI=1S/C10H16/c1-8(2)10-6-4-9(3)5-7-10/h4H,5-7H2,1-3H3 |
| InChIKey | MOYAFQVGZZPNRA-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Melaleuca alternifolia (ncbitaxon:164405) | leaf (BTO:0000713) | PubMed (16418522) |
| Roles Classification |
|---|
| Biological Roles: | volatile oil component Any plant metabolite that is found naturally as a component of a volatile oil. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Applications: | insect repellent An insecticide that acts as a repellent to insects. sedative A central nervous system depressant used to induce drowsiness or sleep or to reduce psychological excitement or anxiety. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| terpinolene (CHEBI:9457) has role insect repellent (CHEBI:71692) |
| terpinolene (CHEBI:9457) has role plant metabolite (CHEBI:76924) |
| terpinolene (CHEBI:9457) has role sedative (CHEBI:35717) |
| terpinolene (CHEBI:9457) has role volatile oil component (CHEBI:27311) |
| terpinolene (CHEBI:9457) is a p-menthadiene (CHEBI:50073) |
| Incoming Relation(s) |
| tea tree oil (CHEBI:83629) has part terpinolene (CHEBI:9457) |
| IUPAC Names |
|---|
| 1-methyl-4-(propan-2-ylidene)cyclohexene |
| p-mentha-1,4(8)-diene |
| Synonyms | Source |
|---|---|
| 1,4(8)-p-menthadiene | ChemIDplus |
| 1-methyl-4-(1-methylethylidene)-1-cyclohexene | NIST Chemistry WebBook |
| 1-methyl-4-(1-methylethylidene)cyclohexene | ChemIDplus |
| 4-isopropylidene-1-methylcyclohexene | ChemIDplus |
| isoterpinene | ChemIDplus |
| Terpinolen | ChemIDplus |
| UniProt Name | Source |
|---|---|
| terpinolene | UniProt |
| Manual Xrefs | Databases |
|---|---|
| 2016 | BPDB |
| C00000861 | KNApSAcK |
| C06075 | KEGG COMPOUND |
| CPD-4890 | MetaCyc |
| HMDB0036994 | HMDB |
| LMPR0102090062 | LIPID MAPS |
| Citations |
|---|