EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H20N2O3 |
| Net Charge | 0 |
| Average Mass | 324.380 |
| Monoisotopic Mass | 324.14739 |
| SMILES | O=C(OC1C[C@@H]2CC3C[C@H](C1)N2CC3=O)c1cnc2ccccc12 |
| InChI | InChI=1S/C19H20N2O3/c22-18-10-21-12-5-11(18)6-13(21)8-14(7-12)24-19(23)16-9-20-17-4-2-1-3-15(16)17/h1-4,9,11-14,20H,5-8,10H2/t11?,12-,13+,14? |
| InChIKey | UKTAZPQNNNJVKR-AKJUYKBHSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| LSM-5418 (CHEBI:94561) is a indolyl carboxylic acid (CHEBI:46867) |
| Manual Xrefs | Databases |
|---|---|
| LSM-5418 | LINCS |