EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H25ClN2O3 |
| Net Charge | 0 |
| Average Mass | 388.895 |
| Monoisotopic Mass | 388.15537 |
| SMILES | O=C(O)COCCN1CCN([C@H](c2ccccc2)c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C21H25ClN2O3/c22-19-8-6-18(7-9-19)21(17-4-2-1-3-5-17)24-12-10-23(11-13-24)14-15-27-16-20(25)26/h1-9,21H,10-16H2,(H,25,26)/t21-/m1/s1 |
| InChIKey | ZKLPARSLTMPFCP-OAQYLSRUSA-N |
| Roles Classification |
|---|
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. hypoglycemic agent A drug which lowers the blood glucose level. dermatologic drug A drug used to treat or prevent skin disorders or for the routine care of skin. anti-asthmatic agent Any compound that has anti-asthmatic effects. anti-allergic agent A drug used to treat allergic reactions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-[2-[4-[(R)-(4-chlorophenyl)-phenylmethyl]-1-piperazinyl]ethoxy]acetic acid (CHEBI:94559) has role anti-allergic agent (CHEBI:50857) |
| 2-[2-[4-[(R)-(4-chlorophenyl)-phenylmethyl]-1-piperazinyl]ethoxy]acetic acid (CHEBI:94559) has role anti-asthmatic agent (CHEBI:65023) |
| 2-[2-[4-[(R)-(4-chlorophenyl)-phenylmethyl]-1-piperazinyl]ethoxy]acetic acid (CHEBI:94559) has role antineoplastic agent (CHEBI:35610) |
| 2-[2-[4-[(R)-(4-chlorophenyl)-phenylmethyl]-1-piperazinyl]ethoxy]acetic acid (CHEBI:94559) has role dermatologic drug (CHEBI:50177) |
| 2-[2-[4-[(R)-(4-chlorophenyl)-phenylmethyl]-1-piperazinyl]ethoxy]acetic acid (CHEBI:94559) has role hypoglycemic agent (CHEBI:35526) |
| 2-[2-[4-[(R)-(4-chlorophenyl)-phenylmethyl]-1-piperazinyl]ethoxy]acetic acid (CHEBI:94559) is a diarylmethane (CHEBI:51614) |
| INN | Source |
|---|---|
| levocetirizina | WHO MedNet |
| Synonyms | Source |
|---|---|
| (-)-cetirizine | ChEMBL |
| Cetirizine, (-)- | ChEMBL |
| Cetirizine, (r)- | ChEMBL |
| Cetirizine (r)-form | ChEMBL |
| levocetirizine | ChEMBL |
| Levocetirizine | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 1566 | DrugCentral |
| HMDB0240226 | HMDB |
| LSM-5412 | LINCS |
| Registry Numbers | Sources |
|---|---|
| CAS:130018-77-8 | DrugCentral |
| Citations |
|---|