EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H10O16 |
| Net Charge | 0 |
| Average Mass | 602.372 |
| Monoisotopic Mass | 601.99688 |
| SMILES | O=c1oc2c(O)c3oc(=O)c4c5c(oc(=O)c6cc(O)c(O)c(O)c65)c(O)c5oc(=O)c(c2c2c(O)c(O)c(O)cc12)c3c54 |
| InChI | InChI=1S/C28H10O16/c29-5-1-3-7(17(33)15(5)31)9-13-11-12-14(28(40)44-23(11)19(35)21(9)41-25(3)37)10-8-4(2-6(30)16(32)18(8)34)26(38)42-22(10)20(36)24(12)43-27(13)39/h1-2,29-36H |
| InChIKey | UGAJKWZVPNVCIO-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | astringent A compound that causes the contraction of body tissues, typically used to reduce bleeding from minor abrasions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Terminalin (CHEBI:9454) is a tannin (CHEBI:26848) |
| Synonyms | Source |
|---|---|
| Terminalin | KEGG COMPOUND |
| Gallagic acid | KEGG COMPOUND |