EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H25NO4 |
| Net Charge | 0 |
| Average Mass | 307.390 |
| Monoisotopic Mass | 307.17836 |
| SMILES | COc1cc(OC)c(C(=O)CCCN2CCCC2)c(OC)c1 |
| InChI | InChI=1S/C17H25NO4/c1-20-13-11-15(21-2)17(16(12-13)22-3)14(19)7-6-10-18-8-4-5-9-18/h11-12H,4-10H2,1-3H3 |
| InChIKey | OWYLAEYXIQKAOL-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-(1-pyrrolidinyl)-1-(2,4,6-trimethoxyphenyl)-1-butanone (CHEBI:94538) has role cardiovascular drug (CHEBI:35554) |
| 4-(1-pyrrolidinyl)-1-(2,4,6-trimethoxyphenyl)-1-butanone (CHEBI:94538) is a aromatic ketone (CHEBI:76224) |
| Synonyms | Source |
|---|---|
| buflomedil | ChEMBL |
| Buflomedil | ChEMBL |
| buflomedil HCl | DrugCentral |
| buflomedil hydrochloride | DrugCentral |
| Citations |
|---|