EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H41NO2 |
| Net Charge | 0 |
| Average Mass | 471.685 |
| Monoisotopic Mass | 471.31373 |
| SMILES | CC(C)(C)c1ccc(C(O)CCCN2CCC(C(O)(c3ccccc3)c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C32H41NO2/c1-31(2,3)26-18-16-25(17-19-26)30(34)15-10-22-33-23-20-29(21-24-33)32(35,27-11-6-4-7-12-27)28-13-8-5-9-14-28/h4-9,11-14,16-19,29-30,34-35H,10,15,20-24H2,1-3H3 |
| InChIKey | GUGOEEXESWIERI-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | immunosuppressive agent An agent that suppresses immune function by one of several mechanisms of action. Classical cytotoxic immunosuppressants act by inhibiting DNA synthesis. Others may act through activation of T-cells or by inhibiting the activation of helper cells. In addition, an immunosuppressive agent is a role played by a compound which is exhibited by a capability to diminish the extent and/or voracity of an immune response. anti-HBV agent An antiviral agent that destroys or inhibits the replication of the hepatitis B virus. antiviral agent A substance that destroys or inhibits replication of viruses. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. immunosuppressive agent An agent that suppresses immune function by one of several mechanisms of action. Classical cytotoxic immunosuppressants act by inhibiting DNA synthesis. Others may act through activation of T-cells or by inhibiting the activation of helper cells. In addition, an immunosuppressive agent is a role played by a compound which is exhibited by a capability to diminish the extent and/or voracity of an immune response. anti-asthmatic agent Any compound that has anti-asthmatic effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Terfenadine (CHEBI:9453) has role anti-asthmatic agent (CHEBI:65023) |
| Terfenadine (CHEBI:9453) has role anti-HBV agent (CHEBI:64951) |
| Terfenadine (CHEBI:9453) has role antineoplastic agent (CHEBI:35610) |
| Terfenadine (CHEBI:9453) has role antiviral agent (CHEBI:22587) |
| Terfenadine (CHEBI:9453) has role immunosuppressive agent (CHEBI:35705) |
| Terfenadine (CHEBI:9453) is a diarylmethane (CHEBI:51614) |
| INN | Source |
|---|---|
| terfenadina | WHO MedNet |
| Synonyms | Source |
|---|---|
| NSC-665802 | ChEMBL |
| NSC-758627 | ChEMBL |
| racemic terfenadine | DrugCentral |
| RMI 9918 | ChEMBL |
| RMI-9918 | ChEMBL |
| seldane | DrugCentral |
| Brand Names | Source |
|---|---|
| Histafen | ChEMBL |
| Histafen 120 | ChEMBL |
| Terfenor | ChEMBL |
| Terfenor fte | ChEMBL |
| Terfex | ChEMBL |
| Terfinax 120 | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 2600 | DrugCentral |
| C07463 | KEGG COMPOUND |
| D00521 | KEGG DRUG |
| HMDB0014486 | HMDB |
| LSM-1273 | LINCS |
| Registry Numbers | Sources |
|---|---|
| CAS:50679-08-8 | KEGG COMPOUND |
| Citations |
|---|