EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H20ClN3O3S |
| Net Charge | 0 |
| Average Mass | 345.852 |
| Monoisotopic Mass | 345.09139 |
| SMILES | C[C@@H]1CCC[C@H](C)N1NC(=O)c1ccc(Cl)c(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C14H20ClN3O3S/c1-9-4-3-5-10(2)18(9)17-14(19)11-6-7-12(15)13(8-11)22(16,20)21/h6-10H,3-5H2,1-2H3,(H,17,19)(H2,16,20,21)/t9-,10+ |
| InChIKey | LBXHRAWDUMTPSE-AOOOYVTPSA-N |
| Roles Classification |
|---|
| Application: | cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-chloro-N-[(2S,6R)-2,6-dimethyl-1-piperidinyl]-3-sulfamoylbenzamide (CHEBI:94521) has role cardiovascular drug (CHEBI:35554) |
| 4-chloro-N-[(2S,6R)-2,6-dimethyl-1-piperidinyl]-3-sulfamoylbenzamide (CHEBI:94521) is a sulfonamide (CHEBI:35358) |
| INN | Source |
|---|---|
| clopamida | WHO MedNet |
| Synonyms | Source |
|---|---|
| brinaldix | DrugCentral |
| brinedine | DrugCentral |
| chlosudimeprimyl | DrugCentral |
| clopamide | ChEMBL |
| Clopamide | ChEMBL |
| clopamidum | DrugCentral |
| Brand Name | Source |
|---|---|
| Aquex | ChEMBL |
| Citations |
|---|