EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H18N4O2 |
| Net Charge | 0 |
| Average Mass | 298.346 |
| Monoisotopic Mass | 298.14298 |
| SMILES | O=C(CCNNC(=O)c1ccncc1)NCc1ccccc1 |
| InChI | InChI=1S/C16H18N4O2/c21-15(18-12-13-4-2-1-3-5-13)8-11-19-20-16(22)14-6-9-17-10-7-14/h1-7,9-10,19H,8,11-12H2,(H,18,21)(H,20,22) |
| InChIKey | NOIIUHRQUVNIDD-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-[[oxo(pyridin-4-yl)methyl]hydrazo]-N-(phenylmethyl)propanamide (CHEBI:94510) has functional parent β-amino acid (CHEBI:33706) |
| 3-[[oxo(pyridin-4-yl)methyl]hydrazo]-N-(phenylmethyl)propanamide (CHEBI:94510) has role antidepressant (CHEBI:35469) |
| 3-[[oxo(pyridin-4-yl)methyl]hydrazo]-N-(phenylmethyl)propanamide (CHEBI:94510) is a organonitrogen compound (CHEBI:35352) |
| 3-[[oxo(pyridin-4-yl)methyl]hydrazo]-N-(phenylmethyl)propanamide (CHEBI:94510) is a organooxygen compound (CHEBI:36963) |
| INN | Source |
|---|---|
| nialamida | WHO MedNet |
| Synonyms | Source |
|---|---|
| nialamid | DrugCentral |
| nialamide | ChEMBL |
| Nialamide | ChEMBL |
| niamid | DrugCentral |
| niamidal | DrugCentral |
| niamide | DrugCentral |
| Citations |
|---|