EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H25N |
| Net Charge | 0 |
| Average Mass | 291.438 |
| Monoisotopic Mass | 291.19870 |
| SMILES | CN(C/C=C/C#CC(C)(C)C)Cc1cccc2ccccc12 |
| InChI | InChI=1S/C21H25N/c1-21(2,3)15-8-5-9-16-22(4)17-19-13-10-12-18-11-6-7-14-20(18)19/h5-7,9-14H,16-17H2,1-4H3/b9-5+ |
| InChIKey | DOMXUEMWDBAQBQ-WEVVVXLNSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | P450 inhibitor An enzyme inhibitor that interferes with the activity of cytochrome P450 involved in catalysis of organic substances. EC 1.14.13.132 (squalene monooxygenase) inhibitor An EC 1.14.13.* (oxidoreductase acting on paired donors, incorporating 1 atom of oxygen, with NADH or NADPH as one donor) inhibitor that interferes with the action of squalene monooxygenase (EC 1.14.13.132). sterol biosynthesis inhibitor Any compound that inhibits the biosynthesis of any sterol. antifungal drug Any antifungal agent used to prevent or treat fungal infections in humans or animals. |
| Application: | antifungal drug Any antifungal agent used to prevent or treat fungal infections in humans or animals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| terbinafine (CHEBI:9448) has role EC 1.14.13.132 (squalene monooxygenase) inhibitor (CHEBI:59285) |
| terbinafine (CHEBI:9448) has role P450 inhibitor (CHEBI:50183) |
| terbinafine (CHEBI:9448) has role sterol biosynthesis inhibitor (CHEBI:83317) |
| terbinafine (CHEBI:9448) is a acetylenic compound (CHEBI:73474) |
| terbinafine (CHEBI:9448) is a allylamine antifungal drug (CHEBI:87127) |
| terbinafine (CHEBI:9448) is a enyne (CHEBI:59831) |
| terbinafine (CHEBI:9448) is a naphthalenes (CHEBI:25477) |
| terbinafine (CHEBI:9448) is a tertiary amine (CHEBI:32876) |
| terbinafine (CHEBI:9448) is conjugate base of terbinafine(1+) (CHEBI:77615) |
| Incoming Relation(s) |
| terbinafine(1+) (CHEBI:77615) is conjugate acid of terbinafine (CHEBI:9448) |
| IUPAC Name |
|---|
| (2E)-N,6,6-trimethyl-N-(1-naphthylmethyl)hept-2-en-4-yn-1-amine |
| INNs | Source |
|---|---|
| terbinafina | WHO MedNet |
| terbinafine | KEGG DRUG |
| terbinafinum | WHO MedNet |
| Synonyms | Source |
|---|---|
| (E)-N-(6,6-Dimethyl-2-hepten-4-ynyl)-N-methyl-1-naphthalene methanamine | ChemIDplus |
| (E)-N-(6,6-Dimethyl-2-hepten-4-ynyl)-N-methyl-1-naphthalenemethylamine | ChemIDplus |
| terbinafine | WHO MedNet |
| Manual Xrefs | Databases |
|---|---|
| 2597 | DrugCentral |
| C08079 | KEGG COMPOUND |
| CPD-10571 | MetaCyc |
| D02375 | KEGG DRUG |
| DB00857 | DrugBank |
| HMDB0014995 | HMDB |
| Terbinafine | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4256376 | Reaxys |
| CAS:91161-71-6 | ChemIDplus |
| CAS:91161-71-6 | KEGG COMPOUND |
| Citations |
|---|