EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H25N |
| Net Charge | 0 |
| Average Mass | 291.438 |
| Monoisotopic Mass | 291.19870 |
| SMILES | CN(C/C=C/C#CC(C)(C)C)Cc1cccc2ccccc12 |
| InChI | InChI=1S/C21H25N/c1-21(2,3)15-8-5-9-16-22(4)17-19-13-10-12-18-11-6-7-14-20(18)19/h5-7,9-14H,16-17H2,1-4H3/b9-5+ |
| InChIKey | DOMXUEMWDBAQBQ-WEVVVXLNSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | P450 inhibitor An enzyme inhibitor that interferes with the activity of cytochrome P450 involved in catalysis of organic substances. EC 1.14.13.132 (squalene monooxygenase) inhibitor An EC 1.14.13.* (oxidoreductase acting on paired donors, incorporating 1 atom of oxygen, with NADH or NADPH as one donor) inhibitor that interferes with the action of squalene monooxygenase (EC 1.14.13.132). anti-HBV agent An antiviral agent that destroys or inhibits the replication of the hepatitis B virus. sterol biosynthesis inhibitor Any compound that inhibits the biosynthesis of any sterol. antifungal drug Any antifungal agent used to prevent or treat fungal infections in humans or animals. |
| Applications: | anti-inflammatory agent Any compound that has anti-inflammatory effects. antifungal drug Any antifungal agent used to prevent or treat fungal infections in humans or animals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| terbinafine (CHEBI:9448) has role anti-HBV agent (CHEBI:64951) |
| terbinafine (CHEBI:9448) has role anti-inflammatory agent (CHEBI:67079) |
| terbinafine (CHEBI:9448) has role EC 1.14.13.132 (squalene monooxygenase) inhibitor (CHEBI:59285) |
| terbinafine (CHEBI:9448) has role P450 inhibitor (CHEBI:50183) |
| terbinafine (CHEBI:9448) has role sterol biosynthesis inhibitor (CHEBI:83317) |
| terbinafine (CHEBI:9448) is a acetylenic compound (CHEBI:73474) |
| terbinafine (CHEBI:9448) is a allylamine antifungal drug (CHEBI:87127) |
| terbinafine (CHEBI:9448) is a enyne (CHEBI:59831) |
| terbinafine (CHEBI:9448) is a naphthalenes (CHEBI:25477) |
| terbinafine (CHEBI:9448) is a tertiary amine (CHEBI:32876) |
| terbinafine (CHEBI:9448) is conjugate base of terbinafine(1+) (CHEBI:77615) |
| Incoming Relation(s) |
| terbinafine(1+) (CHEBI:77615) is conjugate acid of terbinafine (CHEBI:9448) |
| IUPAC Name |
|---|
| (2E)-N,6,6-trimethyl-N-(1-naphthylmethyl)hept-2-en-4-yn-1-amine |
| INNs | Source |
|---|---|
| terbinafina | WHO MedNet |
| terbinafine | KEGG DRUG |
| terbinafinum | WHO MedNet |
| Synonyms | Source |
|---|---|
| (E)-N-(6,6-Dimethyl-2-hepten-4-ynyl)-N-methyl-1-naphthalene methanamine | ChemIDplus |
| (E)-N-(6,6-Dimethyl-2-hepten-4-ynyl)-N-methyl-1-naphthalenemethylamine | ChemIDplus |
| SF 86-327 | ChEMBL |
| SF-86-327 | ChEMBL |
| TDT-067 | ChEMBL |
| terbinafine | WHO MedNet |
| Brand Names | Source |
|---|---|
| Lamasil | ChEMBL |
| Lamisil at | ChEMBL |
| Terbinafine component of osurnia | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 2597 | DrugCentral |
| C08079 | KEGG COMPOUND |
| CPD-10571 | MetaCyc |
| D02375 | KEGG DRUG |
| DB00857 | DrugBank |
| HMDB0014995 | HMDB |
| Terbinafine | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4256376 | Reaxys |
| CAS:91161-71-6 | KEGG COMPOUND |
| CAS:91161-71-6 | ChemIDplus |
| Citations |
|---|