EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H8I2O3 |
| Net Charge | 0 |
| Average Mass | 417.968 |
| Monoisotopic Mass | 417.85629 |
| SMILES | O=C(O)CCc1cc(I)c(O)c(I)c1 |
| InChI | InChI=1S/C9H8I2O3/c10-6-3-5(1-2-8(12)13)4-7(11)9(6)14/h3-4,14H,1-2H2,(H,12,13) |
| InChIKey | REWXSFYNOFYMNX-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-(4-hydroxy-3,5-diiodophenyl)propanoic acid (CHEBI:94473) is a benzenes (CHEBI:22712) |
| 3-(4-hydroxy-3,5-diiodophenyl)propanoic acid (CHEBI:94473) is a monocarboxylic acid (CHEBI:25384) |
| Manual Xrefs | Databases |
|---|---|
| LSM-5224 | LINCS |