EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H29NO5 |
| Net Charge | 0 |
| Average Mass | 387.476 |
| Monoisotopic Mass | 387.20457 |
| SMILES | CCC(COC(=O)c1cc(OC)c(OC)c(OC)c1)(c1ccccc1)N(C)C |
| InChI | InChI=1S/C22H29NO5/c1-7-22(23(2)3,17-11-9-8-10-12-17)15-28-21(24)16-13-18(25-4)20(27-6)19(14-16)26-5/h8-14H,7,15H2,1-6H3 |
| InChIKey | LORDFXWUHHSAQU-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3,4,5-trimethoxybenzoic acid [2-(dimethylamino)-2-phenylbutyl] ester (CHEBI:94458) is a trihydroxybenzoic acid (CHEBI:27115) |
| Synonyms | Source |
|---|---|
| (+/-)-Trimebutine | DrugCentral |
| trimebutine maleate | DrugCentral |