EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:9445 - terazosin
| Formula | C19H25N5O4 |
| Net Charge | 0 |
| Average Mass | 387.440 |
| Monoisotopic Mass | 387.19065 |
| SMILES | COc1cc2nc(N3CCN(C(=O)C4CCCO4)CC3)nc(N)c2cc1OC |
| InChI | InChI=1S/C19H25N5O4/c1-26-15-10-12-13(11-16(15)27-2)21-19(22-17(12)20)24-7-5-23(6-8-24)18(25)14-4-3-9-28-14/h10-11,14H,3-9H2,1-2H3,(H2,20,21,22) |
| InChIKey | VCKUSRYTPJJLNI-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | alpha-adrenergic antagonist An agent that binds to but does not activate α-adrenergic receptors thereby blocking the actions of endogenous or exogenous α-adrenergic agonists. α-Adrenergic antagonists are used in the treatment of hypertension, vasospasm, peripheral vascular disease, shock, and pheochromocytoma. |
| Applications: | alpha-adrenergic antagonist An agent that binds to but does not activate α-adrenergic receptors thereby blocking the actions of endogenous or exogenous α-adrenergic agonists. α-Adrenergic antagonists are used in the treatment of hypertension, vasospasm, peripheral vascular disease, shock, and pheochromocytoma. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| terazosin (CHEBI:9445) has role antihypertensive agent (CHEBI:35674) |
| terazosin (CHEBI:9445) has role antineoplastic agent (CHEBI:35610) |
| terazosin (CHEBI:9445) has role α-adrenergic antagonist (CHEBI:37890) |
| terazosin (CHEBI:9445) is a furans (CHEBI:24129) |
| terazosin (CHEBI:9445) is a piperazines (CHEBI:26144) |
| terazosin (CHEBI:9445) is a primary amino compound (CHEBI:50994) |
| terazosin (CHEBI:9445) is a quinazolines (CHEBI:38530) |
| Incoming Relation(s) |
| terazosin hydrochloride dihydrate (CHEBI:9446) has part terazosin (CHEBI:9445) |
| IUPAC Name |
|---|
| 6,7-dimethoxy-2-[4-(tetrahydrofuran-2-ylcarbonyl)piperazin-1-yl]quinazolin-4-amine |
| INNs | Source |
|---|---|
| terazosin | WHO MedNet |
| terazosinum | WHO MedNet |
| térazosine | WHO MedNet |
| terazosina | WHO MedNet |
| Synonyms | Source |
|---|---|
| Terazosin | KEGG COMPOUND |
| Terazosine | KEGG COMPOUND |
| 1-(4-Amino-6,7-dimethoxy-2-quinazolinyl)-4-((tetrahydro-2-furanyl)carbonyl)piperazine | ChemIDplus |