EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H14N2O4 |
| Net Charge | 0 |
| Average Mass | 226.232 |
| Monoisotopic Mass | 226.09536 |
| SMILES | CC(Cc1ccc(O)c(O)c1)(NN)C(=O)O |
| InChI | InChI=1S/C10H14N2O4/c1-10(12-11,9(15)16)5-6-2-3-7(13)8(14)4-6/h2-4,12-14H,5,11H2,1H3,(H,15,16) |
| InChIKey | TZFNLOMSOLWIDK-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-(3,4-dihydroxyphenyl)-2-hydrazinyl-2-methylpropanoic acid (CHEBI:94430) is a benzenes (CHEBI:22712) |
| 3-(3,4-dihydroxyphenyl)-2-hydrazinyl-2-methylpropanoic acid (CHEBI:94430) is a monocarboxylic acid (CHEBI:25384) |
| Manual Xrefs | Databases |
|---|---|
| LSM-5128 | LINCS |