EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H26O4 |
| Net Charge | 0 |
| Average Mass | 354.446 |
| Monoisotopic Mass | 354.18311 |
| SMILES | COc1cc(OC)c2c(c1CC=C(C)C)O[C@H](c1ccccc1)C[C@H]2O |
| InChI | InChI=1S/C22H26O4/c1-14(2)10-11-16-19(24-3)13-20(25-4)21-17(23)12-18(26-22(16)21)15-8-6-5-7-9-15/h5-10,13,17-18,23H,11-12H2,1-4H3/t17-,18+/m1/s1 |
| InChIKey | ADIMMCHZVYYGPW-MSOLQXFVSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tephrowatsin A (CHEBI:9443) has parent hydride (2S)-flavan (CHEBI:36103) |
| tephrowatsin A (CHEBI:9443) has role plant metabolite (CHEBI:76924) |
| tephrowatsin A (CHEBI:9443) is a hydroxyflavan (CHEBI:72010) |
| tephrowatsin A (CHEBI:9443) is a methoxyflavan (CHEBI:72585) |
| IUPAC Name |
|---|
| (2S,4R)-5,7-dimethoxy-8-(3-methylbut-2-en-1-yl)-2-phenyl-3,4-dihydro-2H-chromen-4-ol |
| Synonym | Source |
|---|---|
| (2S,4R)-5,7-dimethoxy-8-(3-methylbut-2-en-1-yl)-2-phenyl-3,4-dihydro-2H-1-benzopyran-4-ol | IUPAC |
| Manual Xrefs | Databases |
|---|---|
| C00001009 | KNApSAcK |
| C09970 | KEGG COMPOUND |
| LMPK12020160 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6575448 | Reaxys |
| CAS:97640-79-4 | KEGG COMPOUND |