EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H28O2 |
| Net Charge | 0 |
| Average Mass | 312.453 |
| Monoisotopic Mass | 312.20893 |
| SMILES | CC=C1C(=O)CC2C3CCC4=CC(=O)CC[C@@]4(C)C3CC[C@@]12C |
| InChI | InChI=1S/C21H28O2/c1-4-16-19(23)12-18-15-6-5-13-11-14(22)7-9-20(13,2)17(15)8-10-21(16,18)3/h4,11,15,17-18H,5-10,12H2,1-3H3/t15?,17?,18?,20-,21+/m1/s1 |
| InChIKey | WDXRGPWQVHZTQJ-IBCYYTABSA-N |
| Roles Classification |
|---|
| Biological Role: | androgen A sex hormone that stimulates or controls the development and maintenance of masculine characteristics in vertebrates by binding to androgen receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| LSM-5093 (CHEBI:94406) has role androgen (CHEBI:50113) |
| LSM-5093 (CHEBI:94406) is a 3-hydroxy steroid (CHEBI:36834) |
| Manual Xrefs | Databases |
|---|---|
| LSM-5093 | LINCS |