EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H26N2O3 |
| Net Charge | 0 |
| Average Mass | 414.505 |
| Monoisotopic Mass | 414.19434 |
| SMILES | Oc1ccc2c3c1O[C@H]1c4nc5ccccc5c4C[C@@]4(O)C(C2)N(CC2CC2)CC[C@]314 |
| InChI | InChI=1S/C26H26N2O3/c29-19-8-7-15-11-20-26(30)12-17-16-3-1-2-4-18(16)27-22(17)24-25(26,21(15)23(19)31-24)9-10-28(20)13-14-5-6-14/h1-4,7-8,14,20,24,27,29-30H,5-6,9-13H2/t20?,24-,25-,26+/m0/s1 |
| InChIKey | WIYUZYBFCWCCQJ-OOGIKFLQSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| LSM-5059 (CHEBI:94384) is a morphinane alkaloid (CHEBI:25418) |
| Manual Xrefs | Databases |
|---|---|
| LSM-5059 | LINCS |