EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H21NO3 |
| Net Charge | 0 |
| Average Mass | 275.348 |
| Monoisotopic Mass | 275.15214 |
| SMILES | CN1[C@H]2CC[C@H]1CC(OC(=O)C(O)c1ccccc1)C2 |
| InChI | InChI=1S/C16H21NO3/c1-17-12-7-8-13(17)10-14(9-12)20-16(19)15(18)11-5-3-2-4-6-11/h2-6,12-15,18H,7-10H2,1H3/t12-,13-,15?/m0/s1 |
| InChIKey | ZTVIKZXZYLEVOL-QNIGDANOSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| [(1S,5S)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] 2-hydroxy-2-phenylacetate (CHEBI:94376) is a tropane alkaloid (CHEBI:37332) |
| Manual Xrefs | Databases |
|---|---|
| LSM-5047 | LINCS |