EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C44H32N4O4 |
| Net Charge | 0 |
| Average Mass | 680.764 |
| Monoisotopic Mass | 680.24236 |
| SMILES | Oc1cccc(-c2c3ccc(n3)c(-c3cccc(O)c3)c3nc(c(-c4cccc(O)c4)c4ccc(n4)c(-c4cccc(O)c4)c4nc2C=C4)CC3)c1 |
| InChI | InChI=1S/C44H32N4O4/c49-29-9-1-5-25(21-29)41-33-13-15-35(45-33)42(26-6-2-10-30(50)22-26)37-17-19-39(47-37)44(28-8-4-12-32(52)24-28)40-20-18-38(48-40)43(36-16-14-34(41)46-36)27-7-3-11-31(51)23-27/h1-17,19,21-24,46-47,49-52H,18,20H2/b41-33-,41-34-,42-35-,42-37-,43-36-,43-38-,44-39-,44-40- |
| InChIKey | LYPFDBRUNKHDGX-LWQDQPMZSA-N |
| Roles Classification |
|---|
| Biological Role: | cofactor An organic molecule or ion (usually a metal ion) that is required by an enzyme for its activity. It may be attached either loosely (coenzyme) or tightly (prosthetic group). |
| Application: | photosensitizing agent A chemical compound that can be excited by light of a specific wavelength and subsequently transfer energy to a chosen reactant. This is commonly molecular oxygen within a cancer tissue, which is converted to (highly rective) singlet state oxygen. This rapidly reacts with any nearby biomolecules, ultimately killing the cancer cells. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| temoporfin (CHEBI:9437) has role photosensitizing agent (CHEBI:47868) |
| temoporfin (CHEBI:9437) is a chlorins (CHEBI:33910) |
| IUPAC Name |
|---|
| 3,3',3'',3'''-(2,3-dihydroporphyrin-5,10,15,20-tetrayl)tetraphenol |
| Synonyms | Source |
|---|---|
| 2,3-dihydro-5,10,15,20-tetra(m-hydroxyphenyl)porphyrin | Patent |
| 3,3',3'',3'''-(7,8-dihydro-21H,23H-porphine-5,10,15,20-tetrayl)tetrakisphenol | ChemIDplus |
| 3,3',3'',3'''-(7,8-dihydroporphyrin-5,10,15,20-tetrayl)tetraphenol | ChemIDplus |
| m-THPC | Patent |
| meso-tetrahydroxyphenylchlorin | ChemIDplus |
| Foscan | KEGG COMPOUND |