EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H39NO9 |
| Net Charge | 0 |
| Average Mass | 545.629 |
| Monoisotopic Mass | 545.26248 |
| SMILES | COC1=C[C@]23CCCN2CCc2cc4c(cc2[C@]3(C)C1OC(=O)[C@@](O)(CCCC(C)(C)O)CC(=O)O)OCO4 |
| InChI | InChI=1S/C29H39NO9/c1-26(2,34)8-5-9-28(35,16-23(31)32)25(33)39-24-22(36-4)15-29-10-6-11-30(29)12-7-18-13-20-21(38-17-37-20)14-19(18)27(24,29)3/h13-15,24,34-35H,5-12,16-17H2,1-4H3,(H,31,32)/t24?,27-,28-,29+/m1/s1 |
| InChIKey | DJIVDDPFKDEQIR-XSEHADPMSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| LSM-5010 (CHEBI:94351) is a benzazepine alkaloid (CHEBI:38523) |
| LSM-5010 (CHEBI:94351) is a cyclic acetal (CHEBI:59770) |
| Manual Xrefs | Databases |
|---|---|
| LSM-5010 | LINCS |