EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H13ClN2O2 |
| Net Charge | 0 |
| Average Mass | 300.745 |
| Monoisotopic Mass | 300.06656 |
| SMILES | CN1C(=O)C(O)N=C(c2ccccc2)c2cc(Cl)ccc21 |
| InChI | InChI=1S/C16H13ClN2O2/c1-19-13-8-7-11(17)9-12(13)14(18-15(20)16(19)21)10-5-3-2-4-6-10/h2-9,15,20H,1H3 |
| InChIKey | SEQDDYPDSLOBDC-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | GABA modulator A substance that does not act as agonist or antagonist but does affect the gamma-aminobutyric acid receptor-ionophore complex. GABA-A receptors appear to have at least three allosteric sites at which modulators act: a site at which benzodiazepines act by increasing the opening frequency of gamma-aminobutyric acid-activated chloride channels; a site at which barbiturates act to prolong the duration of channel opening; and a site at which some steroids may act. |
| Applications: | antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. anxiolytic drug Anxiolytic drugs are agents that alleviate anxiety, tension, and anxiety disorders, promote sedation, and have a calming effect without affecting clarity of consciousness or neurologic conditions. GABA modulator A substance that does not act as agonist or antagonist but does affect the gamma-aminobutyric acid receptor-ionophore complex. GABA-A receptors appear to have at least three allosteric sites at which modulators act: a site at which benzodiazepines act by increasing the opening frequency of gamma-aminobutyric acid-activated chloride channels; a site at which barbiturates act to prolong the duration of channel opening; and a site at which some steroids may act. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Temazepam (CHEBI:9435) has role antidepressant (CHEBI:35469) |
| Temazepam (CHEBI:9435) has role antipsychotic agent (CHEBI:35476) |
| Temazepam (CHEBI:9435) has role anxiolytic drug (CHEBI:35474) |
| Temazepam (CHEBI:9435) is a benzodiazepine (CHEBI:22720) |
| Synonyms | Source |
|---|---|
| levanxene | DrugCentral |
| levanxol | DrugCentral |
| NSC-246303 | ChEMBL |
| Restoril (TN) | KEGG COMPOUND |
| (RS)-Temazepam | DrugCentral |
| Temazepam | KEGG COMPOUND |
| Brand Names | Source |
|---|---|
| Kentepam | ChEMBL |
| Normison | ChEMBL |
| Restoril | ChEMBL |
| Temaz | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 2585 | DrugCentral |
| C07125 | KEGG COMPOUND |
| D00370 | KEGG DRUG |
| HMDB0014376 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:846-50-4 | KEGG COMPOUND |
| Citations |
|---|