EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C33H30N4O2 |
| Net Charge | 0 |
| Average Mass | 514.629 |
| Monoisotopic Mass | 514.23688 |
| SMILES | CCCc1nc2c(C)cc(-c3nc4ccccc4n3C)cc2n1Cc1ccc(-c2ccccc2C(=O)O)cc1 |
| InChI | InChI=1S/C33H30N4O2/c1-4-9-30-35-31-21(2)18-24(32-34-27-12-7-8-13-28(27)36(32)3)19-29(31)37(30)20-22-14-16-23(17-15-22)25-10-5-6-11-26(25)33(38)39/h5-8,10-19H,4,9,20H2,1-3H3,(H,38,39) |
| InChIKey | RMMXLENWKUUMAY-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | EC 3.4.15.1 (peptidyl-dipeptidase A) inhibitor An EC 3.4.15.* (peptidyl-dipeptidase) inhibitor that interferes with the action of peptidyl-dipeptidase A (EC 3.4.15.1). xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. angiotensin receptor antagonist A hormone antagonist that blocks angiotensin receptors. |
| Applications: | EC 3.4.15.1 (peptidyl-dipeptidase A) inhibitor An EC 3.4.15.* (peptidyl-dipeptidase) inhibitor that interferes with the action of peptidyl-dipeptidase A (EC 3.4.15.1). antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. angiotensin receptor antagonist A hormone antagonist that blocks angiotensin receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| telmisartan (CHEBI:9434) has role angiotensin receptor antagonist (CHEBI:61016) |
| telmisartan (CHEBI:9434) has role antihypertensive agent (CHEBI:35674) |
| telmisartan (CHEBI:9434) has role EC 3.4.15.1 (peptidyl-dipeptidase A) inhibitor (CHEBI:35457) |
| telmisartan (CHEBI:9434) has role environmental contaminant (CHEBI:78298) |
| telmisartan (CHEBI:9434) has role xenobiotic (CHEBI:35703) |
| telmisartan (CHEBI:9434) is a benzimidazoles (CHEBI:22715) |
| telmisartan (CHEBI:9434) is a biphenyls (CHEBI:22888) |
| telmisartan (CHEBI:9434) is a carboxybiphenyl (CHEBI:141493) |
| IUPAC Name |
|---|
| 4'-[(1,7'-dimethyl-2'-propyl-1H,3'H-2,5'-bibenzimidazol-3'-yl)methyl][1,1'-biphenyl]-2-carboxylic acid |
| INN | Source |
|---|---|
| telmisartan | ChemIDplus |
| Synonyms | Source |
|---|---|
| 4'-[(1,4'-dimethyl-2'propyl[2,6'-bi-1H-benzimidazol]-1'-yl)methyl]-[1,1'-biphenyl]-2-carboxylic acid | IUPHAR |
| 4'-((1,4'-dimethyl-2'-propyl(2,6'-bi-1H-benzimidazol)-1'-yl)methyl)-(1,1'-biphenyl)-2-carboxylic acid | ChemIDplus |
| 4'-[(1,7'-dimethyl-2'-propyl-1H,3'H-2,5'-bibenzimidazol-3'-yl)methyl]biphenyl-2-carboxylic acid | IUPAC |
| 4'-((4-methyl-6-(1-methyl-2-benzimidazolyl)-2-propyl-1-benzimidazolyl)methyl)-2-biphenylcarboxylic acid | ChemIDplus |
| BIBR 277 | DrugBank |
| Telmisartan | KEGG COMPOUND |
| Brand Name | Source |
|---|---|
| Micardis | KEGG DRUG |
| Manual Xrefs | Databases |
|---|---|
| 2583 | DrugCentral |
| C07710 | KEGG COMPOUND |
| D00627 | KEGG DRUG |
| DB00966 | DrugBank |
| EP502314 | Patent |
| HMDB0015101 | HMDB |
| LSM-3657 | LINCS |
| Telmisartan | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6624054 | Reaxys |
| CAS:144701-48-4 | KEGG COMPOUND |
| CAS:144701-48-4 | ChemIDplus |
| Citations |
|---|