EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:9434 - telmisartan
| Formula | C33H30N4O2 |
| Net Charge | 0 |
| Average Mass | 514.629 |
| Monoisotopic Mass | 514.23688 |
| SMILES | CCCc1nc2c(C)cc(-c3nc4ccccc4n3C)cc2n1Cc1ccc(-c2ccccc2C(=O)O)cc1 |
| InChI | InChI=1S/C33H30N4O2/c1-4-9-30-35-31-21(2)18-24(32-34-27-12-7-8-13-28(27)36(32)3)19-29(31)37(30)20-22-14-16-23(17-15-22)25-10-5-6-11-26(25)33(38)39/h5-8,10-19H,4,9,20H2,1-3H3,(H,38,39) |
| InChIKey | RMMXLENWKUUMAY-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | anti-HIV agent An antiviral agent that destroys or inhibits the replication of the human immunodeficiency virus. EC 3.4.15.1 (peptidyl-dipeptidase A) inhibitor An EC 3.4.15.* (peptidyl-dipeptidase) inhibitor that interferes with the action of peptidyl-dipeptidase A (EC 3.4.15.1). xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. antiviral agent A substance that destroys or inhibits replication of viruses. angiotensin receptor antagonist A hormone antagonist that blocks angiotensin receptors. |
| Applications: | renoprotective agent Any compound that is able to prevent damage to the kidneys. antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. hypoglycemic agent A drug which lowers the blood glucose level. cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. EC 3.4.15.1 (peptidyl-dipeptidase A) inhibitor An EC 3.4.15.* (peptidyl-dipeptidase) inhibitor that interferes with the action of peptidyl-dipeptidase A (EC 3.4.15.1). antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. angiotensin receptor antagonist A hormone antagonist that blocks angiotensin receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| telmisartan (CHEBI:9434) has role angiotensin receptor antagonist (CHEBI:61016) |
| telmisartan (CHEBI:9434) has role anti-HIV agent (CHEBI:64946) |
| telmisartan (CHEBI:9434) has role antihypertensive agent (CHEBI:35674) |
| telmisartan (CHEBI:9434) has role antineoplastic agent (CHEBI:35610) |
| telmisartan (CHEBI:9434) has role antiviral agent (CHEBI:22587) |
| telmisartan (CHEBI:9434) has role cardiovascular drug (CHEBI:35554) |
| telmisartan (CHEBI:9434) has role EC 3.4.15.1 (peptidyl-dipeptidase A) inhibitor (CHEBI:35457) |
| telmisartan (CHEBI:9434) has role environmental contaminant (CHEBI:78298) |
| telmisartan (CHEBI:9434) has role hypoglycemic agent (CHEBI:35526) |
| telmisartan (CHEBI:9434) has role renoprotective agent (CHEBI:231911) |
| telmisartan (CHEBI:9434) has role xenobiotic (CHEBI:35703) |
| telmisartan (CHEBI:9434) is a benzimidazoles (CHEBI:22715) |
| telmisartan (CHEBI:9434) is a biphenyls (CHEBI:22888) |
| telmisartan (CHEBI:9434) is a carboxybiphenyl (CHEBI:141493) |
| IUPAC Name |
|---|
| 4'-[(1,7'-dimethyl-2'-propyl-1H,3'H-2,5'-bibenzimidazol-3'-yl)methyl][1,1'-biphenyl]-2-carboxylic acid |
| INN | Source |
|---|---|
| telmisartan | ChemIDplus |
| Synonyms | Source |
|---|---|
| 4'-[(1,4'-dimethyl-2'propyl[2,6'-bi-1H-benzimidazol]-1'-yl)methyl]-[1,1'-biphenyl]-2-carboxylic acid | IUPHAR |
| 4'-((1,4'-dimethyl-2'-propyl(2,6'-bi-1H-benzimidazol)-1'-yl)methyl)-(1,1'-biphenyl)-2-carboxylic acid | ChemIDplus |
| 4'-[(1,7'-dimethyl-2'-propyl-1H,3'H-2,5'-bibenzimidazol-3'-yl)methyl]biphenyl-2-carboxylic acid | IUPAC |
| 4'-((4-methyl-6-(1-methyl-2-benzimidazolyl)-2-propyl-1-benzimidazolyl)methyl)-2-biphenylcarboxylic acid | ChemIDplus |
| BIBR 277 | DrugBank |
| BIBR-277 | ChEMBL |
| Brand Names | Source |
|---|---|
| Kinzalmono (previously telmisartan boehringer ingelheim pharma kg) | ChEMBL |
| Micardis | KEGG DRUG |
| Telmisartan component of kinzalkomb | ChEMBL |
| Telmisartan component of micardis hct | ChEMBL |
| Telmisartan component of micardisplus | ChEMBL |
| Telmisartan component of onduarp | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 2583 | DrugCentral |
| C07710 | KEGG COMPOUND |
| D00627 | KEGG DRUG |
| DB00966 | DrugBank |
| EP502314 | Patent |
| HMDB0015101 | HMDB |
| LSM-3657 | LINCS |
| Telmisartan | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6624054 | Reaxys |
| CAS:144701-48-4 | KEGG COMPOUND |
| CAS:144701-48-4 | ChemIDplus |
| Citations |
|---|