EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H29N5O |
| Net Charge | 0 |
| Average Mass | 439.563 |
| Monoisotopic Mass | 439.23721 |
| SMILES | O=C(CCCCCCCn1cc(-c2cccnc2)nn1)Nc1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C27H29N5O/c33-27(29-25-16-9-8-15-24(25)22-12-5-4-6-13-22)17-7-2-1-3-10-19-32-21-26(30-31-32)23-14-11-18-28-20-23/h4-6,8-9,11-16,18,20-21H,1-3,7,10,17,19H2,(H,29,33) |
| InChIKey | SJOLTIOPWDLDEB-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | autophagy inducer Any compound that induces the process of autophagy (the self-digestion of one or more components of a cell through the action of enzymes originating within the same cell). EC 2.4.2.12 (nicotinamide phosphoribosyltransferase) inhibitor An EC 2.4.2.* (pentosyltransferase) inhibitor that interferes with the action of nicotinamide phosphoribosyltransferase (EC 2.4.2.12). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| GPP78 (CHEBI:94310) has role autophagy inducer (CHEBI:138880) |
| GPP78 (CHEBI:94310) has role EC 2.4.2.12 (nicotinamide phosphoribosyltransferase) inhibitor (CHEBI:231708) |
| GPP78 (CHEBI:94310) is a biphenyls (CHEBI:22888) |
| GPP78 (CHEBI:94310) is a pyridines (CHEBI:26421) |
| GPP78 (CHEBI:94310) is a secondary carboxamide (CHEBI:140325) |
| GPP78 (CHEBI:94310) is a triazoles (CHEBI:35727) |
| IUPAC Name |
|---|
| N-([biphenyl]-2-yl)-8-[4-(pyridin-3-yl)-1H-1,2,3-triazol-1-yl]octanamide |
| Synonyms | Source |
|---|---|
| CAY 10618 | ChEBI |
| CAY-10618 | ChEBI |
| CAY10618 | ChEBI |
| N-([1,1'-biphenyl]-2-yl)-8-[4-(pyridin-3-yl)-1H-1,2,3-triazol-1-yl]octanamide | ChEBI |
| GPP 78 | ChEBI |
| GPP-78 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LSM-4946 | LINCS |
| Registry Numbers | Sources |
|---|---|
| CAS:1202580-59-3 | ChEBI |
| Citations |
|---|