EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H14N2O6S |
| Net Charge | 0 |
| Average Mass | 434.429 |
| Monoisotopic Mass | 434.05726 |
| SMILES | O=C1N=C(Nc2cccc(C(=O)O)c2)SC1=Cc1ccc(-c2ccc(C(=O)O)cc2)o1 |
| InChI | InChI=1S/C22H14N2O6S/c25-19-18(31-22(24-19)23-15-3-1-2-14(10-15)21(28)29)11-16-8-9-17(30-16)12-4-6-13(7-5-12)20(26)27/h1-11H,(H,26,27)(H,28,29)(H,23,24,25) |
| InChIKey | XVWCAOUMDSZQPB-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-[[5-[[5-(4-carboxyphenyl)-2-furanyl]methylidene]-4-oxo-2-thiazolyl]amino]benzoic acid (CHEBI:94304) is a aminobenzoic acid (CHEBI:22495) |
| Manual Xrefs | Databases |
|---|---|
| LSM-4939 | LINCS |