EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H13Cl2NO4 |
| Net Charge | 0 |
| Average Mass | 366.200 |
| Monoisotopic Mass | 365.02216 |
| SMILES | COc1ccc(C(=O)CC2(O)C(=O)Nc3c(Cl)ccc(Cl)c32)cc1 |
| InChI | InChI=1S/C17H13Cl2NO4/c1-24-10-4-2-9(3-5-10)13(21)8-17(23)14-11(18)6-7-12(19)15(14)20-16(17)22/h2-7,23H,8H2,1H3,(H,20,22) |
| InChIKey | HLXSCTYHLQHQDJ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| YK-4-279 (CHEBI:94301) has role antineoplastic agent (CHEBI:35610) |
| YK-4-279 (CHEBI:94301) has role apoptosis inducer (CHEBI:68495) |
| YK-4-279 (CHEBI:94301) is a aromatic ketone (CHEBI:76224) |
| YK-4-279 (CHEBI:94301) is a indolones (CHEBI:24829) |
| YK-4-279 (CHEBI:94301) is a monomethoxybenzene (CHEBI:25235) |
| YK-4-279 (CHEBI:94301) is a organochlorine compound (CHEBI:36683) |
| YK-4-279 (CHEBI:94301) is a tertiary alcohol (CHEBI:26878) |
| IUPAC Name |
|---|
| 4,7-dichloro-3-hydroxy-3-[2-(4-methoxyphenyl)-2-oxoethyl]-1,3-dihydro-2H-indol-2-one |
| Synonyms | Source |
|---|---|
| YK 4-279 | LINCS |
| 4,7-dichloro-3-hydroxy-3-[2-(4-methoxyphenyl)-2-oxoethyl]-1H-indol-2-one | ChEBI |
| 4,7-dichloro-1,3-dihydro-3-hydroxy-3-[2-(4-methoxyphenyl)-2-oxoethyl]-2H-indol-2-one | ChEBI |
| YK 4279 | ChEBI |
| YK4279 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| DB17428 | DrugBank |
| Registry Numbers | Sources |
|---|---|
| CAS:1037184-44-3 | ChEBI |
| Citations |
|---|