EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H3Cl2N |
| Net Charge | 0 |
| Average Mass | 172.014 |
| Monoisotopic Mass | 170.96425 |
| SMILES | N#Cc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C7H3Cl2N/c8-6-2-1-3-7(9)5(6)4-10/h1-3H |
| InChIKey | YOYAIZYFCNQIRF-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. |
| Biological Roles: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. cellulose synthesis inhibitor An pathway inhibitor that inhibits the synthesis of cellulose. |
| Applications: | agrochemical An agrochemical is a substance that is used in agriculture or horticulture. herbicide A substance used to destroy plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,6-dichlorobenzonitrile (CHEBI:943) has functional parent benzonitrile (CHEBI:27991) |
| 2,6-dichlorobenzonitrile (CHEBI:943) has role agrochemical (CHEBI:33286) |
| 2,6-dichlorobenzonitrile (CHEBI:943) has role cellulose synthesis inhibitor (CHEBI:63958) |
| 2,6-dichlorobenzonitrile (CHEBI:943) has role environmental contaminant (CHEBI:78298) |
| 2,6-dichlorobenzonitrile (CHEBI:943) has role herbicide (CHEBI:24527) |
| 2,6-dichlorobenzonitrile (CHEBI:943) has role xenobiotic (CHEBI:35703) |
| 2,6-dichlorobenzonitrile (CHEBI:943) is a dichlorobenzene (CHEBI:23697) |
| 2,6-dichlorobenzonitrile (CHEBI:943) is a nitrile (CHEBI:18379) |
| IUPAC Name |
|---|
| 2,6-dichlorobenzonitrile |
| Synonyms | Source |
|---|---|
| 2,6-Dichlorobenzonitrile | KEGG COMPOUND |
| Dichlobanil | KEGG COMPOUND |
| dichlobenil | ChemIDplus |
| 2,6-DBN | ChemIDplus |
| 2,6-Dichlorophenyl cyanide | ChemIDplus |
| 2,6-Dichlorobenzoic acid nitrile | NIST Chemistry WebBook |
| Manual Xrefs | Databases |
|---|---|
| C11040 | KEGG COMPOUND |
| 2,6-Dichlorobenzonitrile | Wikipedia |
| dichlobenil | Alan Wood's Pesticides |
| LSM-19017 | LINCS |
| 214 | PPDB |
| Citations |
|---|