EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H22AsN3O6S |
| Net Charge | 0 |
| Average Mass | 411.312 |
| Monoisotopic Mass | 411.04453 |
| SMILES | C[As](C)SC[C@H](NC(=O)CC[C@H](N)C(=O)O)C(=O)NCC(=O)O |
| InChI | InChI=1S/C12H22AsN3O6S/c1-13(2)23-6-8(11(20)15-5-10(18)19)16-9(17)4-3-7(14)12(21)22/h7-8H,3-6,14H2,1-2H3,(H,15,20)(H,16,17)(H,18,19)(H,21,22)/t7-,8-/m0/s1 |
| InChIKey | JGDXFQORBMPJGR-YUMQZZPRSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2S)-2-amino-5-[[(2R)-1-(carboxymethylamino)-3-(dimethylarsinothio)-1-oxopropan-2-yl]amino]-5-oxopentanoic acid (CHEBI:94295) has role antineoplastic agent (CHEBI:35610) |
| (2S)-2-amino-5-[[(2R)-1-(carboxymethylamino)-3-(dimethylarsinothio)-1-oxopropan-2-yl]amino]-5-oxopentanoic acid (CHEBI:94295) is a peptide (CHEBI:16670) |
| INNs | Source |
|---|---|
| darinaparsina | WHO MedNet |
| darinaparsine | WHO MedNet |
| Synonyms | Source |
|---|---|
| darinaparsin | ChEMBL |
| Darinaparsin | ChEMBL |
| ZIO-101 | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| LSM-4924 | LINCS |
| Citations |
|---|