EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H31ClN4O4 |
| Net Charge | 0 |
| Average Mass | 547.055 |
| Monoisotopic Mass | 546.20338 |
| SMILES | CCOc1ccccc1-n1c(C(C)N2CCN(C(=O)COc3ccc(Cl)cc3)CC2)nc2ccccc2c1=O |
| InChI | InChI=1S/C30H31ClN4O4/c1-3-38-27-11-7-6-10-26(27)35-29(32-25-9-5-4-8-24(25)30(35)37)21(2)33-16-18-34(19-17-33)28(36)20-39-23-14-12-22(31)13-15-23/h4-15,21H,3,16-20H2,1-2H3 |
| InChIKey | BKQFRNYHFIQEKN-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | voltage-dependent anion channel inhibitor Any agent that inhibits voltage-dependent anion channels. ferroptosis inducer Any substance that induces or promotes ferroptosis (a type of programmed cell death dependent on iron and characterized by the accumulation of lipid peroxides) in organisms. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| erastin (CHEBI:94287) has role antineoplastic agent (CHEBI:35610) |
| erastin (CHEBI:94287) has role ferroptosis inducer (CHEBI:173085) |
| erastin (CHEBI:94287) has role voltage-dependent anion channel inhibitor (CHEBI:173100) |
| erastin (CHEBI:94287) is a N-acylpiperazine (CHEBI:46844) |
| erastin (CHEBI:94287) is a N-alkylpiperazine (CHEBI:46845) |
| erastin (CHEBI:94287) is a aromatic ether (CHEBI:35618) |
| erastin (CHEBI:94287) is a diether (CHEBI:46786) |
| erastin (CHEBI:94287) is a monochlorobenzenes (CHEBI:83403) |
| erastin (CHEBI:94287) is a quinazolines (CHEBI:38530) |
| erastin (CHEBI:94287) is a tertiary carboxamide (CHEBI:140326) |
| IUPAC Name |
|---|
| 2-(1-{4-[(4-chlorophenoxy)acetyl]piperazin-1-yl}ethyl)-3-(2-ethoxyphenyl)quinazolin-4(3H)-one |
| Synonym | Source |
|---|---|
| 2-[1-[4-[2-(4-chlorophenoxy)acetyl]-1-piperazinyl]ethyl]-3-(2-ethoxyphenyl)-4(3H)-quinazolinone | ChEBI |
| Citations |
|---|