EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H31ClN4O4 |
| Net Charge | 0 |
| Average Mass | 547.055 |
| Monoisotopic Mass | 546.20338 |
| SMILES | CCOc1ccccc1-n1c(C(C)N2CCN(C(=O)COc3ccc(Cl)cc3)CC2)nc2ccccc2c1=O |
| InChI | InChI=1S/C30H31ClN4O4/c1-3-38-27-11-7-6-10-26(27)35-29(32-25-9-5-4-8-24(25)30(35)37)21(2)33-16-18-34(19-17-33)28(36)20-39-23-14-12-22(31)13-15-23/h4-15,21H,3,16-20H2,1-2H3 |
| InChIKey | BKQFRNYHFIQEKN-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | ferroptosis inducer Any substance that induces or promotes ferroptosis (a type of programmed cell death dependent on iron and characterized by the accumulation of lipid peroxides) in organisms. voltage-dependent anion channel inhibitor Any agent that inhibits voltage-dependent anion channels. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| erastin (CHEBI:94287) has role antineoplastic agent (CHEBI:35610) |
| erastin (CHEBI:94287) has role ferroptosis inducer (CHEBI:173085) |
| erastin (CHEBI:94287) has role voltage-dependent anion channel inhibitor (CHEBI:173100) |
| erastin (CHEBI:94287) is a N-acylpiperazine (CHEBI:46844) |
| erastin (CHEBI:94287) is a N-alkylpiperazine (CHEBI:46845) |
| erastin (CHEBI:94287) is a aromatic ether (CHEBI:35618) |
| erastin (CHEBI:94287) is a diether (CHEBI:46786) |
| erastin (CHEBI:94287) is a monochlorobenzenes (CHEBI:83403) |
| erastin (CHEBI:94287) is a quinazolines (CHEBI:38530) |
| erastin (CHEBI:94287) is a tertiary carboxamide (CHEBI:140326) |
| IUPAC Name |
|---|
| 2-(1-{4-[(4-chlorophenoxy)acetyl]piperazin-1-yl}ethyl)-3-(2-ethoxyphenyl)quinazolin-4(3H)-one |
| Synonym | Source |
|---|---|
| 2-[1-[4-[2-(4-chlorophenoxy)acetyl]-1-piperazinyl]ethyl]-3-(2-ethoxyphenyl)-4(3H)-quinazolinone | ChEBI |
| Citations |
|---|