EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H17N3O2 |
| Net Charge | 0 |
| Average Mass | 247.298 |
| Monoisotopic Mass | 247.13208 |
| SMILES | CCCCc1ccc2nc(NC(=O)OC)nc2c1 |
| InChI | InChI=1S/C13H17N3O2/c1-3-4-5-9-6-7-10-11(8-9)15-12(14-10)16-13(17)18-2/h6-8H,3-5H2,1-2H3,(H2,14,15,16,17) |
| InChIKey | YRWLZFXJFBZBEY-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | microtubule-destabilising agent Any substance that interacts with tubulin to inhibit polymerisation of microtubules. |
| Applications: | antinematodal drug A substance used in the treatment or control of nematode infestations. anthelminthic drug Substance intended to kill parasitic worms (helminths). antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| parbendazole (CHEBI:94267) has role anthelminthic drug (CHEBI:35443) |
| parbendazole (CHEBI:94267) has role antinematodal drug (CHEBI:35444) |
| parbendazole (CHEBI:94267) has role antineoplastic agent (CHEBI:35610) |
| parbendazole (CHEBI:94267) has role microtubule-destabilising agent (CHEBI:61951) |
| parbendazole (CHEBI:94267) is a benzimidazoles (CHEBI:22715) |
| parbendazole (CHEBI:94267) is a carbamate ester (CHEBI:23003) |
| IUPAC Name |
|---|
| methyl (5-butyl-1H-benzimidazol-2-yl)carbamate |
| INNs | Source |
|---|---|
| parbendazol | WHO MedNet |
| parbendazole | WHO MedNet |
| parbendazole | WHO MedNet |
| parbendazolum | WHO MedNet |
| Synonyms | Source |
|---|---|
| 5-butyl-2-(carbomethoxyamino)benzimidazole | ChEBI |
| N-(5-butyl-1H-benzimidazol-2-yl)carbamic acid methyl ester | ChEBI |
| methyl 5-butylbenzimidazole-2-carbamate | ChEBI |
| PBZ | ChEBI |
| SK&F 29044 | ChEBI |
| SK&F-29044 | ChEBI |
| Brand Names | Source |
|---|---|
| Helatac | ChEBI |
| Helmatac | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| D05365 | KEGG DRUG |
| H1C | PDBeChem |
| HMDB0256126 | HMDB |
| LSM-4893 | LINCS |
| Registry Numbers | Sources |
|---|---|
| CAS:14255-87-9 | KEGG DRUG |
| Citations |
|---|