EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:9426 - tectochrysin
| Formula | C16H12O4 |
| Net Charge | 0 |
| Average Mass | 268.268 |
| Monoisotopic Mass | 268.07356 |
| SMILES | COc1cc(O)c2c(=O)cc(-c3ccccc3)oc2c1 |
| InChI | InChI=1S/C16H12O4/c1-19-11-7-12(17)16-13(18)9-14(20-15(16)8-11)10-5-3-2-4-6-10/h2-9,17H,1H3 |
| InChIKey | IRZVHDLBAYNPCT-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Alpinia oxyphylla (ncbitaxon:125261) | - | PubMed (23583435) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. antidiarrhoeal drug Any drug found useful in the symptomatic treatment of diarrhoea. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tectochrysin (CHEBI:9426) has functional parent flavone (CHEBI:42491) |
| tectochrysin (CHEBI:9426) has role antidiarrhoeal drug (CHEBI:55323) |
| tectochrysin (CHEBI:9426) has role antineoplastic agent (CHEBI:35610) |
| tectochrysin (CHEBI:9426) has role plant metabolite (CHEBI:76924) |
| tectochrysin (CHEBI:9426) is a monohydroxyflavone (CHEBI:38687) |
| tectochrysin (CHEBI:9426) is a monomethoxyflavone (CHEBI:25401) |
| IUPAC Name |
|---|
| 5-hydroxy-7-methoxy-2-phenyl-4H-1-benzopyran-4-one |
| Synonym | Source |
|---|---|
| 5-hydroxy-7-methoxyflavone | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C00003795 | KNApSAcK |
| C11621 | KEGG COMPOUND |
| LMPK12110190 | LIPID MAPS |
| Techtochrysin | Wikipedia |
| Citations |
|---|