EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H24ClN3O |
| Net Charge | 0 |
| Average Mass | 333.863 |
| Monoisotopic Mass | 333.16079 |
| SMILES | CCc1nn(C)c(C(=O)NCc2ccc(C(C)(C)C)cc2)c1Cl |
| InChI | InChI=1S/C18H24ClN3O/c1-6-14-15(19)16(22(5)21-14)17(23)20-11-12-7-9-13(10-8-12)18(2,3)4/h7-10H,6,11H2,1-5H3,(H,20,23) |
| InChIKey | ZZYSLNWGKKDOML-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | |
| Application: | insecticide Strictly, a substance intended to kill members of the class Insecta. In common usage, any substance used for preventing, destroying, repelling or controlling insects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tebufenpyrad (CHEBI:9422) has role mitochondrial NADH:ubiquinone reductase inhibitor (CHEBI:38498) |
| tebufenpyrad (CHEBI:9422) is a pyrazole acaricide (CHEBI:38602) |
| tebufenpyrad (CHEBI:9422) is a pyrazole insecticide (CHEBI:26409) |
| IUPAC Name |
|---|
| N-(4-tert-butylbenzyl)-4-chloro-3-ethyl-1-methyl-1H-pyrazole-5-carboxamide |
| Synonyms | Source |
|---|---|
| 1H-Pyrazole-5-carboxamide, 4-chloro-N-((4-(1,1-dimethylethyl)phenyl)methyl)-3-ethyl-1-methyl- | KEGG COMPOUND |
| 4-chloro-N-((4-(1,1-dimethylethyl)phenyl)methyl)-3-ethyl-1-methyl-1H-pyrazole-5-carboxamide | ChemIDplus |
| N-(4-t-butylbenzyl)-4-chloro-3-ethyl-1-methylpyrazole-5-carboxamide | ChemIDplus |
| Pyranica | ChemIDplus |
| Tebufenpyrad | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Beilstein:8636471 | Beilstein |
| CAS:119168-77-3 | KEGG COMPOUND |
| CAS:119168-77-3 | ChemIDplus |