EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H27N3O4 |
| Net Charge | 0 |
| Average Mass | 421.497 |
| Monoisotopic Mass | 421.20016 |
| SMILES | CCN(CC)Cc1ccc2cc(COC(=O)Nc3ccc(C(=O)NO)cc3)ccc2c1 |
| InChI | InChI=1S/C24H27N3O4/c1-3-27(4-2)15-17-5-7-21-14-18(6-8-20(21)13-17)16-31-24(29)25-22-11-9-19(10-12-22)23(28)26-30/h5-14,30H,3-4,15-16H2,1-2H3,(H,25,29)(H,26,28) |
| InChIKey | YALNUENQHAQXEA-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. EC 3.5.1.98 (histone deacetylase) inhibitor An EC 3.5.1.* (non-peptide linear amide C-N hydrolase) inhibitor that interferes with the function of histone deacetylase (EC 3.5.1.98). |
| Applications: | anti-inflammatory agent Any compound that has anti-inflammatory effects. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. angiogenesis inhibitor An agent and endogenous substances that antagonize or inhibit the development of new blood vessels. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| givinostat (CHEBI:94187) has role angiogenesis inhibitor (CHEBI:48422) |
| givinostat (CHEBI:94187) has role anti-inflammatory agent (CHEBI:67079) |
| givinostat (CHEBI:94187) has role antineoplastic agent (CHEBI:35610) |
| givinostat (CHEBI:94187) has role apoptosis inducer (CHEBI:68495) |
| givinostat (CHEBI:94187) has role EC 3.5.1.98 (histone deacetylase) inhibitor (CHEBI:61115) |
| givinostat (CHEBI:94187) is a benzenes (CHEBI:22712) |
| givinostat (CHEBI:94187) is a carbamate ester (CHEBI:23003) |
| givinostat (CHEBI:94187) is a hydroxamic acid (CHEBI:24650) |
| givinostat (CHEBI:94187) is a naphthalenes (CHEBI:25477) |
| givinostat (CHEBI:94187) is a tertiary amino compound (CHEBI:50996) |
| givinostat (CHEBI:94187) is conjugate base of givinostat(1+) (CHEBI:231334) |
| Incoming Relation(s) |
| givinostat(1+) (CHEBI:231334) is conjugate acid of givinostat (CHEBI:94187) |
| IUPAC Name |
|---|
| {6-[(diethylamino)methyl]naphthalen-2-yl}methyl [4-(hydroxycarbamoyl)phenyl]carbamate |
| INNs | Source |
|---|---|
| givinostat | WHO MedNet |
| givinostat | WHO MedNet |
| givinostat | WHO MedNet |
| givinostatum | WHO MedNet |
| Synonyms | Source |
|---|---|
| (6-((diethylamino)methyl)naphthalen-2-yl)methyl (4-(hydroxycarbamoyl)phenyl)carbamate | ChEBI |
| [6-[(diethylamino)methyl]naphthalen-2-yl]methyl N-[4-(hydroxycarbamoyl)phenyl]carbamate | ChEBI |
| gavinostat | ChEBI |
| ITF 2357 | ChEBI |
| ITF-2357 | DrugBank |
| ITF2357 | DrugBank |
| Manual Xrefs | Databases |
|---|---|
| D12742 | KEGG DRUG |
| DB12645 | DrugBank |
| Givinostat | Wikipedia |
| HMDB0252732 | HMDB |
| LSM-4807 | LINCS |
| QCM | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| CAS:497833-27-9 | KEGG DRUG |
| Citations |
|---|