EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H21N3O2 |
| Net Charge | 0 |
| Average Mass | 335.407 |
| Monoisotopic Mass | 335.16338 |
| SMILES | CN1CCc2c(c3ccccc3n2Cc2ccc(C(=O)NO)cc2)C1 |
| InChI | InChI=1S/C20H21N3O2/c1-22-11-10-19-17(13-22)16-4-2-3-5-18(16)23(19)12-14-6-8-15(9-7-14)20(24)21-25/h2-9,25H,10-13H2,1H3,(H,21,24) |
| InChIKey | GOVYBPLHWIEHEJ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | EC 3.5.1.98 (histone deacetylase) inhibitor An EC 3.5.1.* (non-peptide linear amide C-N hydrolase) inhibitor that interferes with the function of histone deacetylase (EC 3.5.1.98). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tubastatin A (CHEBI:94186) has role EC 3.5.1.98 (histone deacetylase) inhibitor (CHEBI:61115) |
| tubastatin A (CHEBI:94186) is a hydroxamic acid (CHEBI:24650) |
| tubastatin A (CHEBI:94186) is a pyridoindole (CHEBI:48888) |
| tubastatin A (CHEBI:94186) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| N-hydroxy-4-[(2-methyl-1,2,3,4-tetrahydro-5H-pyrido[4,3-b]indol-5-yl)methyl]benzamide |
| Synonyms | Source |
|---|---|
| N-hydroxy-4-[(2-methyl-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl)methyl]benzamide | LINCS |
| tubastatin-a | LINCS |
| Manual Xrefs | Databases |
|---|---|
| LSM-4806 | LINCS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:20796421 | Reaxys |
| CAS:1252003-15-8 | ChEBI |
| Citations |
|---|