EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H17N3OS |
| Net Charge | 0 |
| Average Mass | 323.421 |
| Monoisotopic Mass | 323.10923 |
| SMILES | CC1=C(NC(=S)NC(=O)c2ccccc2)NCc2ccccc21 |
| InChI | InChI=1S/C18H17N3OS/c1-12-15-10-6-5-9-14(15)11-19-16(12)20-18(23)21-17(22)13-7-3-2-4-8-13/h2-10,19H,11H2,1H3,(H2,20,21,22,23) |
| InChIKey | PUBJFPLMXBDARU-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-[[(4-methyl-1,2-dihydroisoquinolin-3-yl)amino]-sulfanylidenemethyl]benzamide (CHEBI:94112) is a benzoic acids (CHEBI:22723) |
| Manual Xrefs | Databases |
|---|---|
| LSM-4719 | LINCS |