EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H9NO |
| Net Charge | 0 |
| Average Mass | 183.210 |
| Monoisotopic Mass | 183.06841 |
| SMILES | c1ccc2c(c1)Nc1ccccc1O2 |
| InChI | InChI=1S/C12H9NO/c1-3-7-11-9(5-1)13-10-6-2-4-8-12(10)14-11/h1-8,13H |
| InChIKey | TZMSYXZUNZXBOL-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | radical scavenger A role played by a substance that can react readily with, and thereby eliminate, radicals. |
| Biological Role: | ferroptosis inhibitor Any substance that inhibits the process of ferroptosis (a type of programmed cell death dependent on iron and characterized by the accumulation of lipid peroxides) in organisms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 10H-phenoxazine (CHEBI:94057) has role ferroptosis inhibitor (CHEBI:173084) |
| 10H-phenoxazine (CHEBI:94057) has role radical scavenger (CHEBI:48578) |
| 10H-phenoxazine (CHEBI:94057) is a phenoxazine (CHEBI:25970) |
| IUPAC Name |
|---|
| 10H-phenoxazine |
| Synonyms | Source |
|---|---|
| phenoxazine | ChemIDplus |
| phenazoxine | ChemIDplus |
| Citations |
|---|