EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H50O |
| Net Charge | 0 |
| Average Mass | 426.729 |
| Monoisotopic Mass | 426.38617 |
| SMILES | [H][C@]12CC[C@]3(C)C(=CC[C@@]4(C)CCC(C)(C)C[C@]43[H])[C@]1(C)CC[C@@]1([H])C(C)(C)[C@@H](O)CC[C@]21C |
| InChI | InChI=1S/C30H50O/c1-25(2)17-18-27(5)13-9-21-29(7)14-10-20-26(3,4)24(31)12-16-28(20,6)22(29)11-15-30(21,8)23(27)19-25/h9,20,22-24,31H,10-19H2,1-8H3/t20-,22+,23+,24-,27-,28-,29-,30+/m0/s1 |
| InChIKey | GGGUGZHBAOMSFJ-GADYQYKKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cupania cinerea (ncbitaxon:298314) | bark (BTO:0001301) | PubMed (21438586) | Crude n-hexane extract of dried and powdered bark |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| taraxerol (CHEBI:9402) has role metabolite (CHEBI:25212) |
| taraxerol (CHEBI:9402) is a pentacyclic triterpenoid (CHEBI:25872) |
| taraxerol (CHEBI:9402) is a secondary alcohol (CHEBI:35681) |
| IUPAC Name |
|---|
| (3S,4aR,6aR,8aR,12aR,12bS,14aR,14bR)-4,4,6a,8a,11,11,12b,14b-octamethyl-1,2,3,4,4a,5,6,6a,8,8a,9,10,11,12,12a,12b,13,14,14a,14b-icosahydropicen-3-ol |
| Synonyms | Source |
|---|---|
| (3β)-D-friedoolean-14-en-3-ol | ChEBI |
| alnulin | ChEBI |
| skimmiol | ChEBI |
| D-friedoolean-14-en-3β-ol | ChemIDplus |
| tiliadin | ChEBI |
| UniProt Name | Source |
|---|---|
| taraxerol | UniProt |
| Citations |
|---|