EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H50O |
| Net Charge | 0 |
| Average Mass | 426.729 |
| Monoisotopic Mass | 426.38617 |
| SMILES | [H][C@]12CC[C@@]3([H])[C@@](C)(CC[C@@]4(C)CCC(=C)[C@@H](C)[C@@]43[H])[C@]1(C)CC[C@@]1([H])C(C)(C)[C@@H](O)CC[C@]21C |
| InChI | InChI=1S/C30H50O/c1-19-11-14-27(5)17-18-29(7)21(25(27)20(19)2)9-10-23-28(6)15-13-24(31)26(3,4)22(28)12-16-30(23,29)8/h20-25,31H,1,9-18H2,2-8H3/t20-,21-,22+,23-,24+,25-,27-,28+,29-,30-/m1/s1 |
| InChIKey | XWMMEBCFHUKHEX-ZJJHUPNDSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| taraxasterol (CHEBI:9401) has parent hydride taraxastane (CHEBI:72618) |
| taraxasterol (CHEBI:9401) has role anti-inflammatory agent (CHEBI:67079) |
| taraxasterol (CHEBI:9401) has role metabolite (CHEBI:25212) |
| taraxasterol (CHEBI:9401) is a pentacyclic triterpenoid (CHEBI:25872) |
| taraxasterol (CHEBI:9401) is a secondary alcohol (CHEBI:35681) |
| IUPAC Name |
|---|
| (3β,18α,19α)-urs-20(30)-en-3-ol |
| Synonyms | Source |
|---|---|
| Taraxasterol | KEGG COMPOUND |
| α-lactucerol | HMDB |
| taraxasterin | HMDB |
| isolactucerol | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C08636 | KEGG COMPOUND |
| LMPR0106180006 | LIPID MAPS |
| CPD-6949 | MetaCyc |
| HMDB0035920 | HMDB |
| C00003757 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| CAS:1059-14-9 | KEGG COMPOUND |
| CAS:1059-14-9 | ChemIDplus |
| Citations |
|---|