EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H20O7 |
| Net Charge | 0 |
| Average Mass | 372.373 |
| Monoisotopic Mass | 372.12090 |
| SMILES | COc1ccc(-c2cc(=O)c3c(OC)c(OC)c(OC)c(OC)c3o2)cc1 |
| InChI | InChI=1S/C20H20O7/c1-22-12-8-6-11(7-9-12)14-10-13(21)15-16(23-2)18(24-3)20(26-5)19(25-4)17(15)27-14/h6-10H,1-5H3 |
| InChIKey | ULSUXBXHSYSGDT-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tangeretin (CHEBI:9400) has role antineoplastic agent (CHEBI:35610) |
| tangeretin (CHEBI:9400) has role plant metabolite (CHEBI:76924) |
| tangeretin (CHEBI:9400) is a pentamethoxyflavone (CHEBI:38724) |
| Incoming Relation(s) |
| gardenin B (CHEBI:79628) has functional parent tangeretin (CHEBI:9400) |
| IUPAC Name |
|---|
| 5,6,7,8-tetramethoxy-2-(4-methoxyphenyl)-4H-chromen-4-one |
| Synonyms | Source |
|---|---|
| 4',5,6,7,8-pentamethoxyflavone | ChemIDplus |
| 5,6,7,8,4'-Pentamethoxyflavone | KEGG COMPOUND |
| 5,6,7,8-tetramethoxy-2-(4-methoxyphenyl)-4H-1-benzopyran-4-one | ChEBI |
| Tangeretin | KEGG COMPOUND |
| tangeritin | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C00001105 | KNApSAcK |
| C10190 | KEGG COMPOUND |
| CN101947215 | Patent |
| CN102344429 | Patent |
| HMDB0030539 | HMDB |
| LMPK12111443 | LIPID MAPS |
| LSM-2548 | LINCS |
| Tangeritin | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:351695 | Reaxys |
| CAS:481-53-8 | KEGG COMPOUND |
| CAS:481-53-8 | ChemIDplus |
| Citations |
|---|