EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H28N2O5S.HCl |
| Net Charge | 0 |
| Average Mass | 444.981 |
| Monoisotopic Mass | 444.14857 |
| SMILES | CCOc1ccccc1OCCN[C@H](C)Cc1ccc(OC)c(S(N)(=O)=O)c1.Cl |
| InChI | InChI=1S/C20H28N2O5S.ClH/c1-4-26-17-7-5-6-8-18(17)27-12-11-22-15(2)13-16-9-10-19(25-3)20(14-16)28(21,23)24;/h5-10,14-15,22H,4,11-13H2,1-3H3,(H2,21,23,24);1H/t15-;/m1./s1 |
| InChIKey | ZZIZZTHXZRDOFM-XFULWGLBSA-N |
| Roles Classification |
|---|
| Biological Role: | alpha-adrenergic antagonist An agent that binds to but does not activate α-adrenergic receptors thereby blocking the actions of endogenous or exogenous α-adrenergic agonists. α-Adrenergic antagonists are used in the treatment of hypertension, vasospasm, peripheral vascular disease, shock, and pheochromocytoma. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. alpha-adrenergic antagonist An agent that binds to but does not activate α-adrenergic receptors thereby blocking the actions of endogenous or exogenous α-adrenergic agonists. α-Adrenergic antagonists are used in the treatment of hypertension, vasospasm, peripheral vascular disease, shock, and pheochromocytoma. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tamsulosin hydrochloride (CHEBI:9399) has part tamsulosin(1+) (CHEBI:142544) |
| tamsulosin hydrochloride (CHEBI:9399) has role antineoplastic agent (CHEBI:35610) |
| tamsulosin hydrochloride (CHEBI:9399) has role α-adrenergic antagonist (CHEBI:37890) |
| tamsulosin hydrochloride (CHEBI:9399) is a hydrochloride (CHEBI:36807) |
| tamsulosin hydrochloride (CHEBI:9399) is enantiomer of ent-tamsulosin hydrochloride (CHEBI:142550) |
| Incoming Relation(s) |
| rac-tamsulosin hydrochloride (CHEBI:142565) has part tamsulosin hydrochloride (CHEBI:9399) |
| rac-tamulosin hydrochloride (CHEBI:142553) has part tamsulosin hydrochloride (CHEBI:9399) |
| ent-tamsulosin hydrochloride (CHEBI:142550) is enantiomer of tamsulosin hydrochloride (CHEBI:9399) |
| IUPAC Name |
|---|
| 5-[(2R)-2-{[2-(2-ethoxyphenoxy)ethyl]amino}propyl]-2-methoxybenzenesulfonamide hydrochloride |
| Synonyms | Source |
|---|---|
| R-(−)-5-(2-((2-(2-ethoxyphenoxy)ethyl)amino)propyl)-2-methoxybenzenesulfonamide hydrochloride | ChemIDplus |
| (−)-(R)-5-(2-((2-(o-ethoxyphenoxy)ethyl)amino)propyl)-2-methoxybenzenesulfonamide monohydrochloride | ChemIDplus |
| LY253351 | ChemIDplus |
| YM 617 | ChemIDplus |
| Brand Names | Source |
|---|---|
| Flomax | KEGG DRUG |
| Harnal | KEGG DRUG |
| (R)-5-(2-((2-(2-ethoxyphenoxy)ethyl)amino)propyl)-2-methoxybenzenesulfonamide monohydrochloride | ChemIDplus |
| Omnic | ChemIDplus |
| Pradif | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 2562 | DrugCentral |
| D01024 | KEGG DRUG |
| DB00706 | DrugBank |
| WO2007031823 | Patent |
| Registry Numbers | Sources |
|---|---|
| Beilstein:6897600 | Beilstein |
| CAS:106463-17-6 | ChemIDplus |